2,3-Difluorophenylacetic acid CAS 145689-41-4
Introduction：Basic information about 2,3-Difluorophenylacetic acid CAS 145689-41-4, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
2,3-Difluorophenylacetic acid Basic information
| Product Name: | 2,3-Difluorophenylacetic acid |
| Synonyms: | RARECHEM AL BO 0630;2-(2,3-DIFLUOROPHENYL)ACETIC ACID;2,3-DIFLUOROBENZENEACETIC ACID;2 3-DIFLUOROPHENYLACETIC ACID 97%;2,3-Difluorophenylaceticacid97%;2,3-Difluorophenylacetic acid;Benzeneacetic acid, 2,3-difluoro-;Acid 2,3-difluoro |
| CAS: | 145689-41-4 |
| MF: | C8H6F2O2 |
| MW: | 172.13 |
| EINECS: | 642-544-7 |
| Product Categories: | Aromatic Phenylacetic Acids and Derivatives;Phenylacetic acid;C8;Carbonyl Compounds;Carboxylic Acids;Fluorobenzene Series;Phenylacetic acid series |
| Mol File: | 145689-41-4.mol |
2,3-Difluorophenylacetic acid Chemical Properties
| Melting point | 116-119 °C (lit.) |
| Boiling point | 258.1±25.0 °C(Predicted) |
| density | 1.373±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| form | Crystalline Powder |
| pka | 3.81±0.10(Predicted) |
| color | White to off-white |
| InChI | InChI=1S/C8H6F2O2/c9-6-3-1-2-5(8(6)10)4-7(11)12/h1-3H,4H2,(H,11,12) |
| InChIKey | UXSQXUSJGPVOKT-UHFFFAOYSA-N |
| SMILES | C1(CC(O)=O)=CC=CC(F)=C1F |
| CAS DataBase Reference | 145689-41-4(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xi,Xn |
| Risk Statements | 36/37/38-22 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| HazardClass | IRRITANT |
| HS Code | 29163990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| Chemical Properties | White solid |
| Uses | 2,3-Difluorophenylacetic acid may be used in chemical synthesis. |
| Synthesis | 1036273-31-0 145689-41-4 Example 19: Synthesis of 2-(2,3-difluorophenyl)acetic acidUsing methyl 2,3-difluorophenylacetate (CAS: 1036273-31-0) as a raw material, the following was performed:1. 10 mL of water and 0.8 mL of 30% sodium hydroxide solution were added to 0.3 g of methyl 2,3-difluorophenylacetate.2. the reaction mixture was stirred at 60 °C for 1 h until the reaction was complete.3. After completion of the reaction, the mixture was acidified to pH=1 with concentrated hydrochloric acid.4. The product was separated by filtration to afford 2-(2,3-difluorophenyl)acetic acid as a white solid in a yield of 0.2 g (72% yield).Product Characterization:1H-NMR (300 MHz, CDCl3): δ (ppm): 3.75 (s, 2H); 7.01-7.06 (m, 3H); 9.4 (bs, 1H). |
| References | [1] Patent: WO2008/78350, 2008, A2. Location in patent: Page/Page column 23 |
2,3-Difluorophenylacetic acid Preparation Products And Raw materials
| Raw materials | Methyl (2,3-difluorophenyl)acetate-->Hydrochloric acid |
| Preparation Products | 2,6-Difluorophenylacetic acid-->2-(2,3-Difluoro-6-nitrophenyl)acetic acid |
