Introduction：Basic information about 2,3-DIMETHYL-2H-INDAZOL-6-AMINE CAS 444731-72-0, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
2,3-DIMETHYL-2H-INDAZOL-6-AMINE Basic information
| Product Name: | 2,3-DIMETHYL-2H-INDAZOL-6-AMINE |
| Synonyms: | 2,3-DIMETHYL-2H-INDAZOL-6-AMINE;6-Amino-2,3-dimethyl-2H-i...;6-Amino-2,3-dimethyl-2H-indazole;2,3-dimethyl-2H-indazol-6-ylamine;2,3-Dimethyl-6-amino-2H-indazole;3-Dimethyl-2H-indazol-6-amine;2H-Indazol-6-aMine, 2,3-diMethyl-;2,3-dimethyl-6-indazolamine |
| CAS: | 444731-72-0 |
| MF: | C9H11N3 |
| MW: | 161.2 |
| EINECS: | |
| Product Categories: | |
| Mol File: | 444731-72-0.mol |
|
2,3-DIMETHYL-2H-INDAZOL-6-AMINE Chemical Properties
| Boiling point | 366.9±22.0 °C(Predicted) |
| density | 1.23±0.1 g/cm3(Predicted) |
| storage temp. | 2-8°C, protect from light |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| form | Solid |
| pka | 4.20±0.30(Predicted) |
| color | Dark Brown to Very Dark Orange |
| InChI | InChI=1S/C9H11N3/c1-6-8-4-3-7(10)5-9(8)11-12(6)2/h3-5H,10H2,1-2H3 |
| InChIKey | PVNVSSNARYHLRF-UHFFFAOYSA-N |
| SMILES | N1=C2C(C=CC(N)=C2)=C(C)N1C |
Safety Information
2,3-DIMETHYL-2H-INDAZOL-6-AMINE Usage And Synthesis
| Uses | 2,3-Dimethyl-6-amino-2H-indazole is an impurity in the synthesis of Pazopanib (P210925) hydrochloride, an oral angiogenesis inhibitor targeting VEGFR and PDGFR. |
2,3-DIMETHYL-2H-INDAZOL-6-AMINE Preparation Products And Raw materials
| Preparation Products | N-(2-Chloropyrimidin-4-YL)-2,3-dimethyl-2H-indazol-6-amine |
