Introduction：Basic information about 2',4',6'-TRIMETHOXYACETOPHENONE CAS 832-58-6, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
2',4',6'-TRIMETHOXYACETOPHENONE Basic information
| Product Name: | 2',4',6'-TRIMETHOXYACETOPHENONE |
| Synonyms: | PHLOROACETOPHENONE TRIMETHYL ETHER;TIMTEC-BB SBB005891;2,4,6-TRIMETHOXYACETOPHENONE;O-Methylxanthoxylin;2',4',6'-Trimethoxyacetophenone 97%;1-(2,4,6-Trimethoxyphenyl)ethanone;1-(2,4,6-Trimethoxy-phenyl)-ethanone;Phloracetophenone trimethyl ether |
| CAS: | 832-58-6 |
| MF: | C11H14O4 |
| MW: | 210.23 |
| EINECS: | |
| Product Categories: | Aromatic Acetophenones & Derivatives (substituted);C11 to C12;Carbonyl Compounds;Ketones |
| Mol File: | 832-58-6.mol |
|
2',4',6'-TRIMETHOXYACETOPHENONE Chemical Properties
| Melting point | 98-102 °C(lit.) |
| Boiling point | 343.0±37.0 °C(Predicted) |
| density | 1.089±0.06 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | Soluble in chloroform. |
| form | solid |
| color | Off-white to light yellow |
| BRN | 519324 |
| InChI | InChI=1S/C11H14O4/c1-7(12)11-9(14-3)5-8(13-2)6-10(11)15-4/h5-6H,1-4H3 |
| InChIKey | KPZWHZSIXZXDMW-UHFFFAOYSA-N |
| SMILES | C(=O)(C1=C(OC)C=C(OC)C=C1OC)C |
| CAS DataBase Reference | 832-58-6(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HS Code | 29145090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 |
2',4',6'-TRIMETHOXYACETOPHENONE Usage And Synthesis
| Uses | 2',4',6'-Trimethoxyacetophenone is used in the production of 4,2',4',6'-tetramethoxy-chalcone. |
| Preparation | Preparation by reaction of dimethyl sulfate with phloroacetophenone. |
2',4',6'-TRIMETHOXYACETOPHENONE Preparation Products And Raw materials
| Raw materials | 2,4,6-Trimethoxybenzoic acid-->2'-HYDROXY-4',6'-DIMETHOXYACETOPHENONE-->Acetyl chloride-->2',4',6'-Trihydroxyacetophenone monohydrate-->Acetonitrile-->Dimethyl sulfate-->Iodomethane-->1,3,5-Trimethoxybenzene |
| Preparation Products | SINENSETIN |
