Introduction：Basic information about 2,4-Dichloro-5-nitrophenol CAS 39489-77-5, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
2,4-Dichloro-5-nitrophenol Basic information
| Product Name: | 2,4-Dichloro-5-nitrophenol |
| Synonyms: | 2,4-DICHLORO-5-NITROPHENOL;2,4-dichloro-5-nitrobenzenol;2,4-Dichloro-5-nitrophenol >Phenol, 2,4-dichloro-5-nitro-;2,4-Dichloro-5-nitropheno |
| CAS: | 39489-77-5 |
| MF: | C6H3Cl2NO3 |
| MW: | 208 |
| EINECS: | |
| Product Categories: | |
| Mol File: | 39489-77-5.mol |
|
2,4-Dichloro-5-nitrophenol Chemical Properties
| Melting point | 96-98°C |
| Boiling point | 311.2±42.0 °C(Predicted) |
| density | 1.682±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| form | Solid |
| pka | 6.09±0.24(Predicted) |
| color | Light Tan |
| BRN | 1733418 |
| InChI | InChI=1S/C6H3Cl2NO3/c7-3-1-4(8)6(10)2-5(3)9(11)12/h1-2,10H |
| InChIKey | OFAPWTOOMSVMIU-UHFFFAOYSA-N |
| SMILES | C1(O)=CC([N+]([O-])=O)=C(Cl)C=C1Cl |
| CAS DataBase Reference | 39489-77-5(CAS DataBase Reference) |
Safety Information
| Risk Statements | 20/21/22-36/37/38 |
| Safety Statements | 26-36/37/39 |
| RIDADR | 2811 |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 2908990000 |
2,4-Dichloro-5-nitrophenol Usage And Synthesis
| Uses | 2,4-Dichloro-5-nitrophenol is an intermediate used to prepare (5-Substituted-pyrrolidinyl-2-carbonyl)-2-cyanopyrrolidines as Potent Dipeptidyl Peptidase IV Inhibitors. It is also used to synthesize cyanopyrrolo[2,3-d]pyrimidine derivatives as Hsp90 inhibitors. |
2,4-Dichloro-5-nitrophenol Preparation Products And Raw materials
| Raw materials | Nitric acid-->2,4-Dichlorophenol-->244TRICHLORODIPHENYLETHER-->Piperidine-->Chloroform |
| Preparation Products | 1,5-dichloro-2-(1-methylethoxy)-4-nitrobenzene-->2,4-Dinitrodiphenylamine |
