Introduction：Basic information about CAS 616-55-7|2,4-Di-tert-butyl-6-methylphenol, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2,4-Di-tert-butyl-6-methylphenol |
|---|
| CAS Number | 616-55-7 | Molecular Weight | 220.350 |
|---|
| Density | 0.9±0.1 g/cm3 | Boiling Point | 269.0±0.0 °C at 760 mmHg |
|---|
| Molecular Formula | C15H24O | Melting Point | 50-52ºC |
|---|
| MSDS | / | Flash Point | 123.0±8.4 °C |
|---|
Names
| Name | 2,4-ditert-butyl-6-methylphenol |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 0.9±0.1 g/cm3 |
|---|
| Boiling Point | 269.0±0.0 °C at 760 mmHg |
|---|
| Melting Point | 50-52ºC |
|---|
| Molecular Formula | C15H24O |
|---|
| Molecular Weight | 220.350 |
|---|
| Flash Point | 123.0±8.4 °C |
|---|
| Exact Mass | 220.182709 |
|---|
| PSA | 20.23000 |
|---|
| LogP | 5.32 |
|---|
| Vapour Pressure | 0.0±0.5 mmHg at 25°C |
|---|
| Index of Refraction | 1.499 |
|---|
| InChIKey | ZZZRZBIPCKQDQR-UHFFFAOYSA-N |
|---|
| SMILES | Cc1cc(C(C)(C)C)cc(C(C)(C)C)c1O |
|---|
Safety Information
Synonyms
| 4,6-DI-TERT-BUTYL-2-METHYLPHENOL |
| 4,6-di-tert-butyl-o-cresol |
| 2,4-Di-tert-butyl-6-methylphenol |
| 2-Methyl-4,6-bis(2-methyl-2-propanyl)phenol |
| Phenol, 2,4-bis(1,1-dimethylethyl)-6-methyl- |
| 2-Hydroxy-1-methyl-3.5-di-tert.-butyl-benzol |
| Phenol, 4,6-di(1,1-dimethylethyl)-2-methyl- |
| 2-methyl-4,6-di-t-butylphenol |
