Introduction：Basic information about 2,4-Dichloro-9,9-dimethyl-9H-fluorene CAS 1799918-67-4, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
2,4-Dichloro-9,9-dimethyl-9H-fluorene Basic information
| Product Name: | 2,4-Dichloro-9,9-dimethyl-9H-fluorene |
| Synonyms: | 2,4-DICHLORO-9,9-DIMETHYL-9H-FLUORENE;9H-Fluorene, 2,4-dichloro-9,9-dimethyl- |
| CAS: | 1799918-67-4 |
| MF: | C15H12Cl2 |
| MW: | 263.16 |
| EINECS: | |
| Product Categories: | |
| Mol File: | 1799918-67-4.mol |
|
2,4-Dichloro-9,9-dimethyl-9H-fluorene Chemical Properties
| Boiling point | 371.1±37.0 °C(Predicted) |
| density | 1.249±0.06 g/cm3(Predicted) |
| InChI | InChI=1S/C15H12Cl2/c1-15(2)11-6-4-3-5-10(11)14-12(15)7-9(16)8-13(14)17/h3-8H,1-2H3 |
| InChIKey | PTEBIUITKMWZKT-UHFFFAOYSA-N |
| SMILES | C1(C)(C)C2=C(C=CC=C2)C2=C1C=C(Cl)C=C2Cl |
Safety Information
2,4-Dichloro-9,9-dimethyl-9H-fluorene Usage And Synthesis
2,4-Dichloro-9,9-dimethyl-9H-fluorene Preparation Products And Raw materials
