Introduction：Basic information about 2,4-Dichlorophenylhydrazine hydrochloride CAS 5446-18-4, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
2,4-Dichlorophenylhydrazine hydrochloride Basic information
| Product Name: | 2,4-Dichlorophenylhydrazine hydrochloride |
| Synonyms: | 1-(2,4-DICHLOROPHENYL)HYDRAZINE HYDROCHLORIDE;2,4-DICHLOROPHENYLHYDRAZINE HCL;2,4-DICHLOROPHENYLHYDRAZINE HYDROCHLORIDE;(2,4-dichlorophenyl)hydrazine monohydrochloride;2,4-Dichoropheynylhydrazine hydrochloride;4-Bromo-3-Aminoacetophdnone;Hydrazine, (2,4-dichlorophenyl)-, monohydrochloride;2,4-Dichlorophenylhydrazine hydrochloride 99% |
| CAS: | 5446-18-4 |
| MF: | C6H7Cl3N2 |
| MW: | 213.49 |
| EINECS: | 226-659-6 |
| Product Categories: | Aromatic Hydrazides, Hydrazines, Hydrazones and Oximes;Phenylhydrazine;API intermediates;Hydrazines;Nitrogen Compounds;Organic Building Blocks;Amines and Anilines;Halides;bc0001 |
| Mol File: | 5446-18-4.mol |
|
2,4-Dichlorophenylhydrazine hydrochloride Chemical Properties
| Melting point | 220-224 °C(lit.) |
| storage temp. | Inert atmosphere,Room Temperature |
| form | Crystalline Powder |
| color | Off-white to light brown |
| Water Solubility | soluble |
| BRN | 3708828 |
| InChI | InChI=1S/C6H6Cl2N2.ClH/c7-4-1-2-6(10-9)5(8)3-4;/h1-3,10H,9H2;1H |
| InChIKey | DDWYGJVFURAIJZ-UHFFFAOYSA-N |
| SMILES | C1(NN)=CC=C(Cl)C=C1Cl.Cl |
| CAS DataBase Reference | 5446-18-4(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xi,Xn |
| Risk Statements | 36/37/38-20/21/22 |
| Safety Statements | 26-36-36/37/39-22 |
| WGK Germany | 3 |
| F | 10 |
| Hazard Note | Harmful/Irritant |
| HazardClass | IRRITANT |
| HS Code | 29280000 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
2,4-Dichlorophenylhydrazine hydrochloride Usage And Synthesis
| Chemical Properties | white to light yellow crystal powde |
| Uses | 2,4-Dichlorophenylhydrazine hydrochloride was used in the synthesis of pyrazole analogues of curcumin. |
2,4-Dichlorophenylhydrazine hydrochloride Preparation Products And Raw materials
| Raw materials | Hydrochloric acid-->2,4-Dichloroaniline |
| Preparation Products | Rimonabant hydrochloride-->1-BROMO-2,4-DICHLOROBENZENE-->5-AMINO-1-(2,4-DICHLOROPHENYL)-3-METHYL-1H-PYRAZOLE-4-CARBONITRILE |
