Introduction：Basic information about 2,5,8,11-tetramethyldodec-6-yne-5,8-diol CAS 68227-33-8, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
Table of Contents
- 1. 2,5,8,11-tetramethyldodec-6-yne-5,8-diol Basic information
- 2. 2,5,8,11-tetramethyldodec-6-yne-5,8-diol Chemical Properties
- 3. Safety Information
- 4. 2,5,8,11-tetramethyldodec-6-yne-5,8-diol Usage And Synthesis
- 5. 2,5,8,11-tetramethyldodec-6-yne-5,8-diol Preparation Products And Raw materials
2,5,8,11-tetramethyldodec-6-yne-5,8-diol Basic information
| Product Name: | 2,5,8,11-tetramethyldodec-6-yne-5,8-diol |
| Synonyms: | 2,5,8,11-tetramethyldodec-6-yne-5,8-diol;2,5,8,11-Tetramethyl-6-Dodecyne-5,8-Diol;2,5,8,11-Tetramethyl-6-dodecyn-5,8-diol;6-Dodecyne-5,8-diol, 2,5,8,11-tetramethyl-;2,5,8,11-tetramethyl-6-dodecyne-8-diol;DF 110D;Surfynol 110D;Surfynol 124 |
| CAS: | 68227-33-8 |
| MF: | C16H30O2 |
| MW: | 254.41 |
| EINECS: | 269-348-0 |
| Product Categories: | |
| Mol File: | 68227-33-8.mol |
|
2,5,8,11-tetramethyldodec-6-yne-5,8-diol Chemical Properties
| Boiling point | 269℃ |
| density | 0.935 |
| vapor pressure | 0.005Pa at 25℃ |
| Fp | 101℃ |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| pka | 12.90±0.29(Predicted) |
| form | Solid |
| color | White to Off-White |
| Water Solubility | 92.9mg/L at 20℃ |
| InChI | InChI=1S/C16H30O2/c1-13(2)7-9-15(5,17)11-12-16(6,18)10-8-14(3)4/h13-14,17-18H,7-10H2,1-6H3 |
| InChIKey | RHRRUYIZUBAQTQ-UHFFFAOYSA-N |
| SMILES | CC(C)CCC(C)(O)C#CC(C)(O)CCC(C)C |
| LogP | 4.79 |
| EPA Substance Registry System | 6-Dodecyne-5,8-diol, 2,5,8,11-tetramethyl- (68227-33-8) |
Safety Information
2,5,8,11-tetramethyldodec-6-yne-5,8-diol Usage And Synthesis
| Uses | 2,5,8,11-Tetramethyl-6-dodecyne-5,8-diol can be used as printing apparatus. |
| Application | 2,5,8,11-tetramethyldodec-6-yne-5,8-diol is a surfactant used to lower the surface tension of liquids. It is an organic compound that synergizes with other surfactants in sulfate solutions. 2,5,8,11-tetramethyldodec-6-yne-5,8-diol can be used as an additive in detergents and other products that require a surfactant. This compound also has the potential to be used as a perovskite material for solar cells or batteries due to its optical properties and ability to be structurally modified. |
| Flammability and Explosibility | Non flammable |
2,5,8,11-tetramethyldodec-6-yne-5,8-diol Preparation Products And Raw materials
