Introduction：Basic information about 2-[(Acetyloxy)methoxy]ethyl acetate CAS 59278-00-1, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
2-[(Acetyloxy)methoxy]ethyl acetate Basic information
| Product Name: | 2-[(Acetyloxy)methoxy]ethyl acetate |
| Synonyms: | 2-[(Acetyloxy)methoxy]ethyl acetate;1,4-DIACETOXY-2-OXABUTANE;2-Oxo-1,4-Butanediol Diacetate;(2-Acetoxyethoxy)methylacetate;2-Acetoxyethyl acetoxymethyl ethe;Acecloguanosine lateral chain;2-Acetoxyethyl acetoxymethyl ether;2-[(Acetyloxy)methoxy]ethanol acetate |
| CAS: | 59278-00-1 |
| MF: | C7H12O5 |
| MW: | 176.17 |
| EINECS: | 261-686-7 |
| Product Categories: | Intermediates & Fine Chemicals;Pharmaceuticals |
| Mol File: | 59278-00-1.mol |
|
2-[(Acetyloxy)methoxy]ethyl acetate Chemical Properties
| Boiling point | 114-1180C/4Torr |
| density | 1.1382 g/cm3 |
| refractive index | 1.4210 to 1.4250 |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Chloroform (Slightly), Ethyl Acetate (Slightly), Methanol (Slightly) |
| form | clear liquid |
| color | Colorless to Almost colorless |
| Stability: | Below 40C |
| InChI | InChI=1S/C7H12O5/c1-6(8)11-4-3-10-5-12-7(2)9/h3-5H2,1-2H3 |
| InChIKey | XFEQOLXBMLXKDE-UHFFFAOYSA-N |
| SMILES | C(OC(=O)C)COCOC(C)=O |
| CAS DataBase Reference | 59278-00-1(CAS DataBase Reference) |
Safety Information
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36/37/39 |
| HS Code | 29153900 |
2-[(Acetyloxy)methoxy]ethyl acetate Usage And Synthesis
| Chemical Properties | Bright Yellow Liquid |
| Uses | Intermediate for the preparation of Acyclovir-d4. |
2-[(Acetyloxy)methoxy]ethyl acetate Preparation Products And Raw materials
| Raw materials | Acetic anhydride-->1,3-Dioxolane |
| Preparation Products | 9-(2'-ACETOXYETHOXYMETHYL)-GUANINE |
