Introduction:Basic information about 2’,4’-Di-tert-butylphenyl 3,5-di-tert-butyl-4-hydroxybenzoate CAS 4221-80-1, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
2’,4’-Di-tert-butylphenyl 3,5-di-tert-butyl-4-hydroxybenzoate Basic informationAppearance Uses
| Product Name: | 2’,4’-Di-tert-butylphenyl 3,5-di-tert-butyl-4-hydroxybenzoate |
| Synonyms: | UV-120;2,4-DI-T-BUTYLPHENYL 3,5-DI-T-BUTYL-4-HYDROXYBENZOATE;2,4-DI-TERT-BUTYLPHENYL 3,5-DI-TERT-BUTYL-4-HYDROXYBENZOATE;2,4-di-tert-Butyphenyl-3,5-Di-tert-butyl-4-Hydroxybenzoate;2',4'-Di-tert-butylpheny1 3,5-di-tert-buty1-4-hydroxybenzoate;UV ABSORBER-120;Benzoic acid, 3,5-bis(1,1-dimethylethyl)-4-hydroxy-, 2,4-bis(1,1-dimethylethyl)phenyl ester;3,5-ditert-butyl-4-hydroxy-(2,4-ditert-butylphenyl)benzoate |
| CAS: | 4221-80-1 |
| MF: | C29H42O3 |
| MW: | 438.64 |
| EINECS: | 224-166-0 |
| Product Categories: | Organics |
| Mol File: | 4221-80-1.mol |
|
2’,4’-Di-tert-butylphenyl 3,5-di-tert-butyl-4-hydroxybenzoate Chemical Properties
| Melting point | 195-197°C |
| Boiling point | 521.3±50.0 °C(Predicted) |
| density | 1.001±0.06 g/cm3(Predicted) |
| vapor pressure | 0Pa at 25℃ |
| pka | 8.70±0.40(Predicted) |
| InChI | InChI=1S/C29H42O3/c1-26(2,3)19-13-14-23(20(17-19)27(4,5)6)32-25(31)18-15-21(28(7,8)9)24(30)22(16-18)29(10,11)12/h13-17,30H,1-12H3 |
| InChIKey | KJYSXRBJOSZLEL-UHFFFAOYSA-N |
| SMILES | C(OC1=CC=C(C(C)(C)C)C=C1C(C)(C)C)(=O)C1=CC(C(C)(C)C)=C(O)C(C(C)(C)C)=C1 |
| CAS DataBase Reference | 4221-80-1(CAS DataBase Reference) |
| EPA Substance Registry System | Benzoic acid, 3,5-bis(1,1-dimethylethyl)-4-hydroxy-, 2,4-bis(1,1-dimethylethyl)phenyl ester (4221-80-1) |
Safety Information
2’,4’-Di-tert-butylphenyl 3,5-di-tert-butyl-4-hydroxybenzoate Usage And Synthesis
| Appearance | UV 120 is white crystalline powder. |
| Uses | UV 120 is particularly useful for stabilizing pigmented polymers, especially where the pigment itself promotes polymer degradation. It does not absorb visible light, therefore, it does not add any initial color to the substrate or polymer. |
| Flammability and Explosibility | Not classified |
2’,4’-Di-tert-butylphenyl 3,5-di-tert-butyl-4-hydroxybenzoate Preparation Products And Raw materials