Introduction：Basic information about 2-BROMO-6-CHLORO-4-FLUOROANILINE CAS 201849-14-1, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
2-BROMO-6-CHLORO-4-FLUOROANILINE Basic information
| Product Name: | 2-BROMO-6-CHLORO-4-FLUOROANILINE |
| Synonyms: | 2-Bromo-6-chloro-4-fluoro-Benzenamine;2-BROMO-6-CHLORO-4-FLUOROANILINE;2-Bromo-6-chloro-4-fluoroaniline 98%;2-Bromo-6-chloro-4-fluoroaniline98%;2-Bromo-6-chloro-4-fluoroaniline >Benzenamine, 2-bromo-6-chloro-4-fluoro-;2-BROMO-6-CHLORO-4-FLUOROANILINE ISO 9001：2015 REACH;CAS:201849-14-1 |
| CAS: | 201849-14-1 |
| MF: | C6H4BrClFN |
| MW: | 224.46 |
| EINECS: | |
| Product Categories: | Aryl Fluorinated Building Blocks;Building Blocks;Chemical Synthesis;Fluorinated Building Blocks;Nitrogen Compounds;Organic Building Blocks;Organic Fluorinated Building Blocks;Other Fluorinated Organic Building Blocks;Amines;C2 to C6;Nitrogen Compounds;Anilines, Amides & Amines;Bromine Compounds;Chlorine Compounds;Fluorine Compounds;Anilines, Aromatic Amines and Nitro Compounds;C6 |
| Mol File: | 201849-14-1.mol |
|
2-BROMO-6-CHLORO-4-FLUOROANILINE Chemical Properties
| Melting point | 54-58 °C (lit.) |
| Boiling point | 240.7±35.0 °C(Predicted) |
| density | 1.809±0.06 g/cm3(Predicted) |
| Fp | 225 °F |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| solubility | soluble in Methanol |
| pka | 0.65±0.10(Predicted) |
| form | Crystalline Powder |
| color | Beige to brown |
| InChI | InChI=1S/C6H4BrClFN/c7-4-1-3(9)2-5(8)6(4)10/h1-2H,10H2 |
| InChIKey | LIBGMUMMWYKJSC-UHFFFAOYSA-N |
| SMILES | C1(N)=C(Cl)C=C(F)C=C1Br |
| CAS DataBase Reference | 201849-14-1(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xi,T |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| RIDADR | 2811 |
| WGK Germany | 3 |
| Hazard Note | Toxic |
| HazardClass | 6.1 |
| HS Code | 29214200 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
2-BROMO-6-CHLORO-4-FLUOROANILINE Usage And Synthesis
| Uses | 2-Bromo-6-chloro-4-fluoroaniline is an amine derivative used as a pharmaceutical intermediate. |
2-BROMO-6-CHLORO-4-FLUOROANILINE Preparation Products And Raw materials
