Introduction：Basic information about 2-BROMO-6-FLUOROANILINE CAS 65896-11-9, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
2-BROMO-6-FLUOROANILINE Basic information
| Product Name: | 2-BROMO-6-FLUOROANILINE |
| Synonyms: | 2-BROMO-6-FLUOROANILINE;2-Bromo-6-fluoroaniline, 98+%;2-Bromo-6-fluoroaniline 99%;Letermovir Intermediate 1;2-Bromo-6-fluoroaniline,95%;2-BroMo-6-fluoro-phenylaMine;2-broMo-6-fluorobenzenaMine;2-Bromo-6-fluoroaniline > |
| CAS: | 65896-11-9 |
| MF: | C6H5BrFN |
| MW: | 190.01 |
| EINECS: | 464-930-2 |
| Product Categories: | Aryl Fluorinated Building Blocks;Building Blocks;Chemical Synthesis;Fluorinated Building Blocks;Nitrogen Compounds;Organic Building Blocks;Organic Fluorinated Building Blocks;Other Fluorinated Organic Building Blocks;Aromatics;Anilines, Aromatic Amines and Nitro Compounds;Amines;C2 to C6;Nitrogen Compounds;C6 |
| Mol File: | 65896-11-9.mol |
|
2-BROMO-6-FLUOROANILINE Chemical Properties
| Boiling point | 211.0±20.0 °C(Predicted) |
| density | 1.674 g/mL at 20 °C (lit.) |
| refractive index | n20/D 1.582(lit.) |
| Fp | 82° |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | Chloroform, Ethyl Acetate |
| pka | 1.15±0.10(Predicted) |
| form | Liquid |
| color | Clear yellow to brown |
| BRN | 8541957 |
| InChI | InChI=1S/C6H5BrFN/c7-4-2-1-3-5(8)6(4)9/h1-3H,9H2 |
| InChIKey | ALZFPYUPNVLVQM-UHFFFAOYSA-N |
| SMILES | C1(N)=C(F)C=CC=C1Br |
| CAS DataBase Reference | 65896-11-9(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xi,T |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| RIDADR | UN2810 |
| WGK Germany | 3 |
| Hazard Note | Toxic |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29214200 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
2-BROMO-6-FLUOROANILINE Usage And Synthesis
| Chemical Properties | Clear yellow to brown liquid |
| Uses | 2-BroMo-6-fluoroaniline is used for preparation of cycloalkylated benzothiadiazine derivatives and their use as AMPA receptor modulators. |
2-BROMO-6-FLUOROANILINE Preparation Products And Raw materials
| Preparation Products | 2-Bromo-6-fluoronitrobenzene-->8-fluoro-2-methyl-4H-benzo[d][1,3]oxazin-4-one-->2-IODO-3-BROMOFLUOROBENZENE |
