Introduction：Basic information about 2-Bromo-6-fluorotoluene CAS 1422-54-4, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
2-Bromo-6-fluorotoluene Basic information
| Product Name: | 2-Bromo-6-fluorotoluene |
| Synonyms: | 2-BROMO-6-FLUOROTOLUENE;1-BROMO-3-FLUORO-2-METHYLBENZENE;Bromofluorotoluene3;2-Fluoro-6-Bromo Toluene;6-Bromo-2-fluorotoluene;2-Bromo-6-fluorotoluene 98%;2-Bromo-6-fluorotoluene98%;2-broMo -6-fluorine toluene |
| CAS: | 1422-54-4 |
| MF: | C7H6BrF |
| MW: | 189.02 |
| EINECS: | |
| Product Categories: | Aromatic Halides (substituted);Halogen toluene;Bromine Compounds;Fluorine Compounds |
| Mol File: | 1422-54-4.mol |
|
2-Bromo-6-fluorotoluene Chemical Properties
| Boiling point | 75-76°C 10mm |
| density | 1.53 |
| refractive index | 1.535 |
| Fp | 76°C |
| storage temp. | Sealed in dry,Room Temperature |
| form | clear liquid |
| color | Colorless to Almost colorless |
| BRN | 2433658 |
| InChI | InChI=1S/C7H6BrF/c1-5-6(8)3-2-4-7(5)9/h2-4H,1H3 |
| InChIKey | DJGXPFQIMLEVPA-UHFFFAOYSA-N |
| SMILES | C1(Br)=CC=CC(F)=C1C |
| CAS DataBase Reference | 1422-54-4(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xi,Xn |
| Risk Statements | 36/37/38-51-22 |
| Safety Statements | 26-36/37/39-37 |
| HazardClass | IRRITANT |
| HS Code | 29039990 |
2-Bromo-6-fluorotoluene Usage And Synthesis
| Chemical Properties | Colorlessto light yellow liquid |
| Uses | 2-Bromo-6-fluorotoluene is a toluene derivative, its structure contains bromine and fluorine atom active groups, so it has a high chemical reactivity and easily substitution and fluorination reaction with other compounds. It is mainly used as raw material or intermediate of organic synthesis. |
2-Bromo-6-fluorotoluene Preparation Products And Raw materials
| Preparation Products | 2-Bromo-6-fluorobenzoic acid |
