Introduction:Basic information about 2-Bromo-m-xylene CAS 576-22-7, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
2-Bromo-m-xylene Basic information
| Product Name: | 2-Bromo-m-xylene |
| Synonyms: | 1-BROMO-2,6-DIMETHYLBENZENE;2,6-DIMETHYLBROMOBENZENE;2-BROMO-META-XYLENE;2-BROMO-M-XYLENE;2-BROMO-1,3-DIMETHYLBENZENE;Benzene,2-broMo-1,3-diMethyl-;2,6-DiMethylbroMobenzene, 97+%;2-Bromo-m-xylene |
| CAS: | 576-22-7 |
| MF: | C8H9Br |
| MW: | 185.06 |
| EINECS: | 209-397-7 |
| Product Categories: | Aromatic Hydrocarbons (substituted) & Derivatives;Halogen toluene;Benzene derivates;Bromine Compounds;bc0001 |
| Mol File: | 576-22-7.mol |
|
2-Bromo-m-xylene Chemical Properties
| Melting point | −10 °C(lit.) |
| Boiling point | 206 °C(lit.) |
| density | 1.389 g/mL at 25 °C(lit.) |
| refractive index | n20/D 1.555(lit.) |
| Fp | 165 °F |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Soluble in aqueous solution. Very soluble in ethanol, soluble in acetone and benzene. |
| form | Liquid |
| Specific Gravity | 1.389 |
| color | Clear colorless to yellow |
| BRN | 1929780 |
| InChI | InChI=1S/C8H9Br/c1-6-4-3-5-7(2)8(6)9/h3-5H,1-2H3 |
| InChIKey | MYMYVYZLMUEVED-UHFFFAOYSA-N |
| SMILES | C1(C)=CC=CC(C)=C1Br |
| CAS DataBase Reference | 576-22-7(CAS DataBase Reference) |
| NIST Chemistry Reference | Benzene, 2-bromo-1,3-dimethyl-(576-22-7) |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36-24/25 |
| RIDADR | UN 2810 |
| WGK Germany | 3 |
| RTECS | CY9020000 |
| HazardClass | IRRITANT |
| HS Code | 29039990 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
2-Bromo-m-xylene Usage And Synthesis
| Chemical Properties | CLEAR COLOURLESS TO YELLOW LIQUID |
| Uses | 2-Bromo-m-xylene has been used to prepare 2,2?,4,6,6?-pentamethylbiphenyl. It is used as an intermediate in organic synthesis. |
2-Bromo-m-xylene Preparation Products And Raw materials
| Raw materials | 2,4-Dimethylbromobenzene-->m-Xylene |
| Preparation Products | 2-Bromo-3-methylbenzoic acid-->2-(2,6-DIMETHYLPHENYL)ETHANOL-->2-bromo-5-(tert-butyl)-1,3-dimethylbenzene-->2,6-DIMETHYLACETOPHENONE-->1,3-Benzenedicarboxylic acid, 2-broMo-, 1,3-diMethyl ester-->DiMethyl 2-Hydroxyisophthalate-->2,6-Dimethylbenzyl bromide-->2,5-DIBROMO-M-XYLENE-->1,3-DIMETHYL-2-ETHYLBENZENE-->2,6-Dimethylfluorobenzene-->2',2,2,6'-TETRAMETHYLPROPIOPHENONE |