2-BROMOPROPIONITRILE CAS 19481-82-4
Introduction:Basic information about 2-BROMOPROPIONITRILE CAS 19481-82-4, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
2-BROMOPROPIONITRILE Basic information
| Product Name: | 2-BROMOPROPIONITRILE |
| Synonyms: | 2-BROMOPROPIONITRILE;Propanenitrile, 2-broMo-;2-broMopropanenitrile;2-BroMopropionitrile 97%;Propanenitrile, 2-bromo- (9CI);2-bromopropanenitrile - [B84363] |
| CAS: | 19481-82-4 |
| MF: | C3H4BrN |
| MW: | 133.97 |
| EINECS: | |
| Product Categories: | C1 to C5;Cyanides/Nitriles;Nitrogen Compounds;Building Blocks;C1 to C5;Chemical Synthesis;Nitrogen Compounds;Organic Building Blocks |
| Mol File: | 19481-82-4.mol |
2-BROMOPROPIONITRILE Chemical Properties
| Boiling point | 68-69 °C/50 mmHg (lit.) |
| density | 1.55 g/mL at 25 °C (lit.) |
| refractive index | n |
| Fp | 137 °F |
| storage temp. | Storage temp. -20°C |
| form | liquid |
| Appearance | Colorless to light yellow Liquid |
| InChI | InChI=1S/C3H4BrN/c1-3(4)2-5/h3H,1H3 |
| InChIKey | PYNYHMRMZOGVML-UHFFFAOYSA-N |
| SMILES | C(#N)C(Br)C |
Safety Information
| Hazard Codes | Xn |
| Risk Statements | 20/21/22-36/37/38 |
| Safety Statements | 23-26-28-36/37/39 |
| RIDADR | UN 1993 3/PG 3 |
| WGK Germany | 3 |
| HazardClass | 3.2 |
| PackingGroup | III |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Flam. Liq. 3 Skin Irrit. 2 STOT SE 3 |
| Uses | 2-Bromopropionitrile was used as an initiator in the atom transfer radical polymerization using activators generated by electron transfer (AGET ATRP) of acrylonitrile and the reaction was catalysed by Yb-based catalyst. |
2-BROMOPROPIONITRILE Preparation Products And Raw materials
| Raw materials | 2-BROMOPROPIONAMIDE-->Propionitrile-->Lactonitrile-->Acrylonitrile |
