Introduction：Basic information about 2-Butyl-3-(3,5-Diiodo-4-hydroxy benzoyl) benzofuran CAS 1951-26-4, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
2-Butyl-3-(3,5-Diiodo-4-hydroxy benzoyl) benzofuran Basic information
| Product Name: | 2-Butyl-3-(3,5-Diiodo-4-hydroxy benzoyl) benzofuran |
| Synonyms: | 2-Butyl-3-benzofuranyl3,5-diiodo-4-hydroxyphenylketone;3-(4-hydroxy-3,5-diiodo)-benzoyl-2-butylbenzofuran;2-butyl-3-benzofuranyl 4-hydroxy-3,5-diiodophenyl ketone;(2-butyl-3-benzofuranyl)(4-hydroxy-3,5-diiodophenyl)-methanone;2-BUTYL-3-(3',5'-DIIODO-4-HYDROXYBENZONYL)BENZOFURAN;2-BUTYL-3-(3',5-DIIODO-4-HYDROXYBENZONYL)-BENZOFURAN;2-BUTYL-3-(3,5-DIIODO-4-HYDROXY BENZOYL)BENZOFURAN;2-BUTYL-3-(4-HYDROXY3,5-DIIODOBENYL)-BENZOFURAN |
| CAS: | 1951-26-4 |
| MF: | C19H16I2O3 |
| MW: | 546.14 |
| EINECS: | 217-773-7 |
| Product Categories: | Heterocyclic Compounds;Heterocycles;Inhibitors;Intermediates & Fine Chemicals;Pharmaceuticals;BUILDING BLOCKS;Furan&Benzofuran;1 |
| Mol File: | 1951-26-4.mol |
|
2-Butyl-3-(3,5-Diiodo-4-hydroxy benzoyl) benzofuran Chemical Properties
| Melting point | 142-144°C |
| Boiling point | 536.8±50.0 °C(Predicted) |
| density | 1.864 |
| storage temp. | Refrigerator |
| solubility | DMSO (Slightly), Methanol (Slightly, Heated, Sonicated) |
| form | Solid |
| pka | 4.84±0.25(Predicted) |
| color | Off-White to Pale Beige |
| Major Application | pharmaceutical
pharmaceutical small molecule |
| InChI | InChI=1S/C19H16I2O3/c1-2-3-7-16-17(12-6-4-5-8-15(12)24-16)18(22)11-9-13(20)19(23)14(21)10-11/h4-6,8-10,23H,2-3,7H2,1H3 |
| InChIKey | PNFMEGSMKIHDFZ-UHFFFAOYSA-N |
| SMILES | C(C1C2=CC=CC=C2OC=1CCCC)(C1=CC(I)=C(O)C(I)=C1)=O |
| CAS DataBase Reference | 1951-26-4(CAS DataBase Reference) |
Safety Information
| WGK Germany | 3 |
| HS Code | 2932996560 |
| Storage Class | 11 - Combustible Solids |
2-Butyl-3-(3,5-Diiodo-4-hydroxy benzoyl) benzofuran Usage And Synthesis
| Chemical Properties | Off-White Solid |
| Uses | 2-Butyl-3-(3,5-diiodo-4-hydroxybenzoyl)benzofuran (Amiodarone EP Impurity D) is a related compound of Amiodarone, a non-selective ion channel blocker. |
| Definition | ChEBI: (2-Butylbenzofuran-3-yl)(4-hydroxy-3,5-diiodophenyl)ketone is a member of benzofurans. |
2-Butyl-3-(3,5-Diiodo-4-hydroxy benzoyl) benzofuran Preparation Products And Raw materials
| Preparation Products | AZIMILIDE-->Amiodarone hydrochloride |
