Introduction:Basic information about 2-Butyl-3-(4-hydroxybenzoyl)benzofuran CAS 52490-15-0, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
2-Butyl-3-(4-hydroxybenzoyl)benzofuran Basic information
| Product Name: | 2-Butyl-3-(4-hydroxybenzoyl)benzofuran |
| Synonyms: | (2-butyl-3-benzofuranyl)(4-hydroxyphenyl)-methanone;2-butyl-3-benzofuranyl p-hydroxyphenyl ketone;2-BUTYL-3-(P-HYDROXYLBENZONYL)-BENZOFURAN;2-BUTYL-3-(4-HYDROXYBENZOYL)-BENZOFURAN;2-BUTYL-3-(4-HYDROXYLBENZONYL)BENZOFURAN;(2-butylbenzofuran-3-yl) (4-hydroxyphenyl) ketone;2-Butyl-3-(4-hydroxybenzoyl)benzofurane;4-[(2-butyl-3-benzofuranyl)methyl]-5-hydroxy-1-cyclohexa-2,4-dienone |
| CAS: | 52490-15-0 |
| MF: | C19H18O3 |
| MW: | 294.34 |
| EINECS: | 257-959-5 |
| Product Categories: | Aromatics Compounds;Aromatics;Heterocycles;Intermediates & Fine Chemicals;Pharmaceuticals;BUILDING BLOCKS;Furan&Benzofuran |
| Mol File: | 52490-15-0.mol |
|
2-Butyl-3-(4-hydroxybenzoyl)benzofuran Chemical Properties
| Melting point | 119 °C |
| Boiling point | 490.6±40.0 °C(Predicted) |
| density | 1.183 |
| storage temp. | Refrigerator |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| pka | 7.69±0.15(Predicted) |
| form | Solid |
| color | White to Off-White |
| Major Application | pharmaceutical small molecule |
| InChI | InChI=1S/C19H18O3/c1-2-3-7-17-18(15-6-4-5-8-16(15)22-17)19(21)13-9-11-14(20)12-10-13/h4-6,8-12,20H,2-3,7H2,1H3 |
| InChIKey | ZHGKQUXXASLVQQ-UHFFFAOYSA-N |
| SMILES | C(C1C2=CC=CC=C2OC=1CCCC)(C1=CC=C(O)C=C1)=O |
| CAS DataBase Reference | 52490-15-0(CAS DataBase Reference) |
Safety Information
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 2932996560 |
| Storage Class | 11 - Combustible Solids |
2-Butyl-3-(4-hydroxybenzoyl)benzofuran Usage And Synthesis
| Chemical Properties | Off-White Solid |
| Uses | Inhibitor of enzyme |
| Definition | ChEBI: (2-Butylbenzofuran-3-yl)(4-hydroxyphenyl)ketone is a member of benzofurans. |
| Flammability and Explosibility | Non flammable |
2-Butyl-3-(4-hydroxybenzoyl)benzofuran Preparation Products And Raw materials