Introduction：Basic information about 2-Chloro-4-trifluoromethylbenzoic acid CAS 23228-45-7, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
2-Chloro-4-trifluoromethylbenzoic acid Basic information
| Product Name: | 2-Chloro-4-trifluoromethylbenzoic acid |
| Synonyms: | 2-chloro-4-(trifluoromethyl)benzoic acid;2-CHLORO-4-TRIFLUOROMETHYL BENZOIC ACID,98%;4-Carboxy-3-chlorobenzotrifluoride;BENZOIC ACID, 2-CHLORO-4-(TRIFLUOROMETHYL)-;2-Chloro-4-(trifluoromethyl)benzoic acid 97%;2-Chloro-4-(trifluoromethyl)benzoicacid,97% |
| CAS: | 23228-45-7 |
| MF: | C8H4ClF3O2 |
| MW: | 224.56 |
| EINECS: | |
| Product Categories: | |
| Mol File: | 23228-45-7.mol |
|
2-Chloro-4-trifluoromethylbenzoic acid Chemical Properties
| Melting point | 114-117℃ |
| Boiling point | 255 °C |
| density | 1.523 |
| Fp | 108 °C |
| storage temp. | Sealed in dry,Room Temperature |
| pka | 2.33±0.25(Predicted) |
| form | crystals |
| color | Large white |
| InChI | InChI=1S/C8H4ClF3O2/c9-6-3-4(8(10,11)12)1-2-5(6)7(13)14/h1-3H,(H,13,14) |
| InChIKey | DTIJZEUKFYGSEC-UHFFFAOYSA-N |
| SMILES | C(O)(=O)C1=CC=C(C(F)(F)F)C=C1Cl |
| CAS DataBase Reference | 23228-45-7 |
Safety Information
2-Chloro-4-trifluoromethylbenzoic acid Usage And Synthesis
| Chemical Properties | colorless or light yellow liquid |
2-Chloro-4-trifluoromethylbenzoic acid Preparation Products And Raw materials
| Raw materials | 3-CHLORO-4-IODOBENZOTRIFLUORIDE-->3-Chlorobenzotrifluoride-->carbon monoxide-->Carbon dioxide-->Water-->1,4-Dioxane-->Triphenylphosphine-->Triethylamine-->Palladium (II) Acetate |
