Introduction：Basic information about 2-Chloroanthraquinone CAS 131-09-9, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
2-Chloroanthraquinone Basic information
| Product Name: | 2-Chloroanthraquinone |
| Synonyms: | anthraquinone,2-chloro-;β-chloroanthrapuinone;Melting point standard 2-chloroanthraquinone;2-Chloroanthraqukinone;MELTING POINT STANDARD 2-CHLORO- &;2-Chloranthrachinon;2-Chloroanthraquinone,99%;2-Chloroanthraquinone,97% |
| CAS: | 131-09-9 |
| MF: | C14H7ClO2 |
| MW: | 242.66 |
| EINECS: | 205-010-0 |
| Product Categories: | API Intermediate;Organics;Electronic Chemicals;Anthraquinones;Chloroanthraquine, etc.;C13 to C14;Intermediates of Dyes and Pigments;Carbonyl Compounds;Ketones |
| Mol File: | 131-09-9.mol |
|
2-Chloroanthraquinone Chemical Properties
| Melting point | 209-211 °C (lit.) |
| Boiling point | 345.65°C (rough estimate) |
| density | 1.2377 (rough estimate) |
| refractive index | 1.5380 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| form | powder to crystal |
| color | White to Light orange to Yellow |
| Water Solubility | insoluble |
| BRN | 2051842 |
| InChI | InChI=1S/C14H7ClO2/c15-8-5-6-11-12(7-8)14(17)10-4-2-1-3-9(10)13(11)16/h1-7H |
| InChIKey | FPKCTSIVDAWGFA-UHFFFAOYSA-N |
| SMILES | C1=C2C(C(=O)C3=C(C2=O)C=CC=C3)=CC=C1Cl |
| CAS DataBase Reference | 131-09-9(CAS DataBase Reference) |
| NIST Chemistry Reference | 2-Chloroanthraquinone(131-09-9) |
| EPA Substance Registry System | 9,10-Anthracenedione, 2-chloro- (131-09-9) |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38-43-36/37 |
| Safety Statements | 26-36-37/39-24 |
| WGK Germany | 1 |
| RTECS | CB6151000 |
| F | 10 |
| TSCA | TSCA listed |
| HS Code | 29147090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Skin Sens. 1 |
2-Chloroanthraquinone Usage And Synthesis
| Chemical Properties | Pale yellow needle crystal. Insoluble in water, soluble in hot benzene, nitrobenzene, concentrated sulfuric acid. |
| Uses | 2-Chloroanthraquinone is an important dye intermediate that can be used to make alizarin and aminoanthraquinone. This product has been evaluated as a photo-reagent for the analysis of ginsenosides using photoreduction fluorescence (PRF) detection method. |
| Preparation | 2-Chloroanthraquinone is prepared by condensing phthalic anhydride and chlorobenzene into p-chlorobenzoylbenzoic acid, and then cyclizing it with sulfuric acid. |
| Synthesis Reference(s) | Tetrahedron Letters, 24, p. 5499, 1983 DOI: 10.1016/S0040-4039(00)94122-4 |
2-Chloroanthraquinone Preparation Products And Raw materials
| Raw materials | Phthalic anhydride-->Chlorobenzene |
| Preparation Products | 2-AMINOANTHRAQUINONE-->2-Chloroanthracene-->Alizarin-->N-[4-[(9,10-Dihydro-9,10-dioxoanthracen-2-yl)amino]-9,10-dihydro-9,10-dioxoanthracen-1-yl]benzamide |
