Introduction：Basic information about 2-CHLOROBIPHENYL CAS 2051-60-7, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
2-CHLOROBIPHENYL Basic information
| Product Name: | 2-CHLOROBIPHENYL |
| Synonyms: | 1-Chloro-2-phenylbenzene;2-chloro-1,1’-biphenyl;2-Chloro-1,1'-biphenyl;2-chloro-bipheny;2-Chlorodiphenyl;Biphenyl, 2-chloro-;PCB 1;O-CHLORODIPHENYL |
| CAS: | 2051-60-7 |
| MF: | C12H9Cl |
| MW: | 188.65 |
| EINECS: | 218-125-6 |
| Product Categories: | |
| Mol File: | 2051-60-7.mol |
|
2-CHLOROBIPHENYL Chemical Properties
| Melting point | 32-34 |
| Boiling point | 274℃ |
| density | 1.1499 g/cm3 (32.5 ºC) |
| refractive index | 1.5830 (estimate) |
| storage temp. | Room Temperature |
| solubility | Chloroform, DMSO (Sparingly), Methanol (Slightly) |
| color | White to Pale Yellow |
| Water Solubility | 7.8mg/L(25 ºC) |
| BRN | 1907934 |
| Stability: | Stable. Incompatible with strong oxidizing agents. |
| InChI | InChI=1S/C12H9Cl/c13-12-9-5-4-8-11(12)10-6-2-1-3-7-10/h1-9H |
| InChIKey | LAXBNTIAOJWAOP-UHFFFAOYSA-N |
| SMILES | C1(C2=CC=CC=C2)=CC=CC=C1Cl |
| CAS DataBase Reference | 2051-60-7(CAS DataBase Reference) |
| EPA Substance Registry System | 2-Chlorobiphenyl (2051-60-7) |
Safety Information
| Hazard Codes | Xi,N |
| Risk Statements | 33-50/53 |
| Safety Statements | 35-60-61 |
| RIDADR | 3077 |
| WGK Germany | 3 |
| RTECS | DV2065000 |
| Hazard Note | Irritant |
| HazardClass | 9 |
| PackingGroup | III |
| HS Code | 2903998090 |
2-CHLOROBIPHENYL Usage And Synthesis
| Chemical Properties | powder |
| Uses | 2-Chlorobiphenyl can be used to treat TP receptor antagonists. |
| Definition | ChEBI: A monochlorobiphenyl carrying a single chloro substituent at position 2. |
2-CHLOROBIPHENYL Preparation Products And Raw materials
| Preparation Products | Triphenylene-->2-(Diphenylphosphino)-biphenyl-->N-methylbiphenyl-2-amine-->Biphenyl |
