Introduction：Basic information about 2-Chlorothioxanthone CAS 86-39-5, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
2-Chlorothioxanthone Basic information
| Product Name: | 2-Chlorothioxanthone |
| Synonyms: | 2-chloro-9h-thioxanthen-9-on;2-chloro-9H-Thioxanthen-9-one;2-Chlorothoxanthone;2-CHLOROTHIAXANTHONE;2-CHLOROTHIOXANTHEN-9-ONE;2-CHLOROTHIOXANTHENE-9-ONE;2-CHLOROTHIOXANTHONE;9H-THIOXANTHEN-9-ONE, 2-CHLORO- |
| CAS: | 86-39-5 |
| MF: | C13H7ClOS |
| MW: | 246.71 |
| EINECS: | 201-667-2 |
| Product Categories: | pharmacetical;Thioderivates;Functional Materials;Photopolymerization Initiators;Organic Photoinitiators;Polymerization Initiators;Thioxanthones |
| Mol File: | 86-39-5.mol |
|
2-Chlorothioxanthone Chemical Properties
| Melting point | 152.5-153.5 °C(lit.) |
| Boiling point | 409.4±44.0 °C(Predicted) |
| density | 1.53 g/cm3 |
| Fp | 196 °F |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| form | powder |
| color | Light yellow to Yellow to Green |
| Water Solubility | Partly miscible in water. |
| InChI | InChI=1S/C13H7ClOS/c14-8-5-6-12-10(7-8)13(15)9-3-1-2-4-11(9)16-12/h1-7H |
| InChIKey | ZCDADJXRUCOCJE-UHFFFAOYSA-N |
| SMILES | C1(=O)C2=C(C=CC=C2)SC2=C1C=C(Cl)C=C2 |
| CAS DataBase Reference | 86-39-5(CAS DataBase Reference) |
| EPA Substance Registry System | 9H-Thioxanthen-9-one, 2-chloro- (86-39-5) |
Safety Information
| Hazard Codes | F |
| Risk Statements | 11 |
| Safety Statements | 16-33 |
| RIDADR | UN 1325 4.1/PG 3 |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| HazardClass | 4.1 |
| PackingGroup | III |
| HS Code | 29349990 |
| Storage Class | 4.1B - Flammable solid hazardous materials |
| Hazard Classifications | Flam. Sol. 2 |
2-Chlorothioxanthone Usage And Synthesis
| Chemical Properties | Beige powder |
| Uses | 2-Chlorothioxanthone is used as pharmaceutical intermediate. |
2-Chlorothioxanthone Preparation Products And Raw materials
| Raw materials | Anthranilic acid-->4-Chlorothiophenol-->Diphenyl sulfide-->NSC54679-->2-(4-chlorophenylthio)benzoic acid-->2-CHLORO-9-(3-DIMETHYLAMINOPROPYLIDENE)THIOXANTHENE-->Thiosalicylic acid-->Chlorobenzene |
| Preparation Products | 2-CHLORO-9-(3-(DIMETHYLAMINO)PROPYL)-TH&-->clopenthixol-->Chlorprothixene-->4-chloro-9H-thioxanthen-9-one-->2-amino-9H-thioxanthen-9-one |
