Introduction：Basic information about 2-Methoxy-5-nitrophenol CAS 636-93-1, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
2-Methoxy-5-nitrophenol Basic information
| Product Name: | 2-Methoxy-5-nitrophenol |
| Synonyms: | 5 nitroguaiacol, 2-methoxy-5-nitrophenol;Phenol, 2-methoxy-5-nitro-;2-Methoxy-5-nitrophenol 98%;2-METHOXY-5-NITROPHENOL / 5-NITROGUAIACOL;2-METHOXY-5-NITROANILINE;2-Methoxy-5-nitrophenol ,99%;2-Methoxy-5-nitrophe;2-Hydroxy-1-methoxy-4-nitrobenzene |
| CAS: | 636-93-1 |
| MF: | C7H7NO4 |
| MW: | 169.13 |
| EINECS: | 211-269-0 |
| Product Categories: | Aromatic Phenols;Phenoles and thiophenoles;Building Blocks;C6 to C8;Chemical Synthesis;Organic Building Blocks;Oxygen Compounds;Phenols |
| Mol File: | 636-93-1.mol |
|
2-Methoxy-5-nitrophenol Chemical Properties
| Melting point | 103-107 °C (lit.) |
| Boiling point | 110-112 °C/1 mmHg (lit.) |
| density | 1.3375 (estimate) |
| refractive index | 1.5830 (rough estimate) |
| Fp | 110-112°C/1mm |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | Chloroform (Slightly), DMSO (Slightly), Methanol (Slightly) |
| pka | 8.31±0.19(Predicted) |
| form | Solid |
| color | Light Yellow to Light Brown |
| BRN | 2047074 |
| InChI | InChI=1S/C7H7NO4/c1-12-7-3-2-5(8(10)11)4-6(7)9/h2-4,9H,1H3 |
| InChIKey | KXKCTSZYNCDFFG-UHFFFAOYSA-N |
| SMILES | C1(O)=CC([N+]([O-])=O)=CC=C1OC |
| CAS DataBase Reference | 636-93-1(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xn,Xi |
| Risk Statements | 22-36/37/38 |
| Safety Statements | 26-36 |
| RIDADR | 2811 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| PackingGroup | III |
| HS Code | 29095090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
2-Methoxy-5-nitrophenol Usage And Synthesis
| Chemical Properties | Yellow to light brown powder |
| Uses | 2-Methoxy-5-nitrophenol is used in the synthesis of potent VEGF and tyrosine kinase inhibitors. Also used in the synthesis of GABA analogues and phosphodiesterase inhibitors such as rolipram. |
| Definition | ChEBI: 2-Methoxy-5-nitrophenol is a member of 3-nitrophenols. |
| Synthesis Reference(s) | Chemical and Pharmaceutical Bulletin, 28, p. 1287, 1980 DOI: 10.1248/cpb.28.1287 |
| General Description | 2-Methoxy-5-nitrophenol is the substitution photoproduct formed on irradiation of 2-chloro-4-nitroanisole at 25°C in aqueous NaOH. |
2-Methoxy-5-nitrophenol Preparation Products And Raw materials
| Preparation Products | 4,5-DIMETHOXY-2-NITROTOLUENE-->2-Fluoro-4-nitrophenol-->2-(3-CHLOROPROPOXY)-1-METHOXY-4-NITROBENZENE-->4-NITROCATECHOL-->1-METHOXY-4-NITRO-2-(2-PROPYNYLOXY)BENZENE-->3-[2-(dimethylamino)ethoxy]-4-methoxybenzenamine-->SB 216641 HYDROCHLORIDE |
