Introduction：Basic information about CAS 33930-79-9|1(2H)-Isoquinolinone, 2-methyl-4-nitro-, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 1(2H)-Isoquinolinone, 2-methyl-4-nitro- |
|---|
| CAS Number | 33930-79-9 | Molecular Weight | 204.18200 |
|---|
| Density | 1.4g/cm3 | Boiling Point | 367.4ºC at 760mmHg |
|---|
| Molecular Formula | C10H8N2O3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 176ºC |
|---|
Names
| Name | 2-methyl-4-nitroisoquinolin-1-one |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.4g/cm3 |
|---|
| Boiling Point | 367.4ºC at 760mmHg |
|---|
| Molecular Formula | C10H8N2O3 |
|---|
| Molecular Weight | 204.18200 |
|---|
| Flash Point | 176ºC |
|---|
| Exact Mass | 204.05300 |
|---|
| PSA | 67.82000 |
|---|
| LogP | 1.96990 |
|---|
| Index of Refraction | 1.646 |
|---|
| InChIKey | RYXPUBRGQYMEJB-UHFFFAOYSA-N |
|---|
| SMILES | Cn1cc([N+](=O)[O-])c2ccccc2c1=O |
|---|
Safety Information
Customs
| HS Code | 2933790090 |
|---|
| Summary | 2933790090. other lactams. VAT:17.0%. Tax rebate rate:9.0%. . MFN tariff:9.0%. General tariff:20.0% |
|---|
Synonyms
| QC-843 |
| 2-methyl-4-nitro-2H-isoquinolin-1-one |
| 2-methyl-4-nitro-isoquinolone |
| 4-Nitro-2-methyl-1-isochinolon |
| 4-Nitro-N-methyl-isocarbostyril |
| 2-Methyl-4-nitroisocarbostyril |
