2-Methoxybenzonitrile CAS 6609-56-9
Introduction：Basic information about 2-Methoxybenzonitrile CAS 6609-56-9, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
2-Methoxybenzonitrile Basic information
| Product Name: | 2-Methoxybenzonitrile |
| Synonyms: | O-CYANOANISOLE;O-METHOXYBENZONITRILE;1-Cyano-2-methoxybenzene;2-Methoxybenzonitrile,98%;2-Cyanoanisole, o-Anisonitrile;AKOS B005792;AKOS 91422;2-METHOXYBENZONITRILE |
| CAS: | 6609-56-9 |
| MF: | C8H7NO |
| MW: | 133.15 |
| EINECS: | 229-559-0 |
| Product Categories: | Aromatic Nitriles;Nitriles;C8 to C9;Cyanides/Nitriles;Nitrogen Compounds |
| Mol File: | 6609-56-9.mol |
2-Methoxybenzonitrile Chemical Properties
| Melting point | 24.5°C |
| Boiling point | 135 °C12 mm Hg(lit.) |
| density | 1.093 g/mL at 25 °C(lit.) |
| refractive index | n |
| Fp | >230 °F |
| storage temp. | Sealed in dry,Room Temperature |
| Water Solubility | Slightly soluble in water |
| form | Liquid |
| color | Clear colorless to pale yellow |
| BRN | 2207134 |
| InChI | InChI=1S/C8H7NO/c1-10-8-5-3-2-4-7(8)6-9/h2-5H,1H3 |
| InChIKey | FSTPMFASNVISBU-UHFFFAOYSA-N |
| SMILES | C(#N)C1=CC=CC=C1OC |
| CAS DataBase Reference | 6609-56-9(CAS DataBase Reference) |
| NIST Chemistry Reference | o-Methoxybenzonitrile(6609-56-9) |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-37/39 |
| RIDADR | 3276 |
| WGK Germany | 3 |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29269090 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| Chemical Properties | Colorless liquid |
| Uses | 2-Methoxybenzonitrile was used in the synthesis of 5-(4′-methyl [1,1′-biphenyl]-2-yl)-1H-tetrazole. |
| Preparation | o-Anisidine with sodium nitrite to make a diazonium salt solution, add it to the lead cyanide solution, and then add benzene. Put the mixture for 10-15h and carry out steam distillation, separate the benzene layer from the distillate, dry it with calcium chloride, evaporate the benzene, and distill the residue under reduced pressure, collect 120-122.5°C (1.2kPa fraction) to get 2-Methoxybenzonitrile, yield 64.5-67.3%. |
| Synthesis Reference(s) | Journal of the American Chemical Society, 77, p. 109, 1955 DOI: 10.1021/ja01606a035 Synthesis, p. 641, 1992 Tetrahedron Letters, 32, p. 1007, 1991 DOI: 10.1016/S0040-4039(00)74473-X |
| General Description | Surface-enhanced Raman spectra study of 2-methoxybenzonitrile has been reported. |
2-Methoxybenzonitrile Preparation Products And Raw materials
| Raw materials | o-Anisidine |
| Preparation Products | 2-METHOXY-6-(5,5-DIMETHYL-1,3,2-DIOXABORINAN-2-YL)BENZONITRILE-->2-METHOXY-BENZAMIDINE HCL-->2-METHOXY-BENZAMIDINE HCL-->N'-HYDROXY-2-METHOXYBENZENECARBOXIMIDAMIDE |
