Introduction：Basic information about 2-Octyl cyanoacetate CAS 52688-08-1, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
2-Octyl cyanoacetate Basic information
| Product Name: | 2-Octyl cyanoacetate |
| Synonyms: | Octan-2-yl 2-cyanoacetate;Acetic acid, cyano-, 1-methylheptyl ester;1-Methylheptyl cyanoacetate;sec-Octyl cyanoacetate;Cyanoacetic acid isooctyl ester;2-OCTYL CYANOACETATE 98.0+%;2-cyanodecanoate;2-OCTYL CYANOACETATE |
| CAS: | 52688-08-1 |
| MF: | C11H19NO2 |
| MW: | 197.27 |
| EINECS: | 251-228-4 |
| Product Categories: | |
| Mol File: | 52688-08-1.mol |
|
2-Octyl cyanoacetate Chemical Properties
| Boiling point | 241.4±8.0 °C(Predicted) |
| density | 0.951±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| pka | 2.94±0.10(Predicted) |
| Appearance | Colorless to light green Liquid |
| InChI | InChI=1S/C11H19NO2/c1-3-4-5-6-7-10(2)14-11(13)8-9-12/h10H,3-8H2,1-2H3 |
| InChIKey | UHQCFCZBVFECRZ-UHFFFAOYSA-N |
| SMILES | C(OC(C)CCCCCC)(=O)CC#N |
Safety Information
| RIDADR | UN3276 |
| HazardClass | 6.1 |
2-Octyl cyanoacetate Usage And Synthesis
| Chemical Properties | Colorless to light yellow liquid |
| Uses | 2-Octyl cyanoacetate is the main raw material for the synthesis of α-cyanoacrylate adhesives. α-Cyanoacrylate adhesives are the earliest discovered and most widely used tissue adhesives. |
| Preparation | 2-Octyl cyanoacetate was obtained by direct esterification of cyanoacetic acid with octan-2-ol in a 1:1 molar ratio in the presence of two/three drops of 2% concentrated sulphuric acid as a catalyst and toluene as solvent, to allow for the azeotropic removal of the reaction water.
|
2-Octyl cyanoacetate Preparation Products And Raw materials
| Raw materials | DL-2-Octanol-->2-Octanol-->Cyanoacetic acid |
