Introduction：Basic information about 2-Thiazolamine, 4-(4,5-dichloro-2-thienyl)- CAS 959042-70-7, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
2-Thiazolamine, 4-(4,5-dichloro-2-thienyl)- Basic information
| Product Name: | 2-Thiazolamine, 4-(4,5-dichloro-2-thienyl)- |
| Synonyms: | 2-Thiazolamine, 4-(4,5-dichloro-2-thienyl)-;Avatrombopag Impurity 20;4-(4,5-Dichlorothiophen-2-yl)thiazol-2-amine (Avatrombopag Impurity) |
| CAS: | 959042-70-7 |
| MF: | C7H4Cl2N2S2 |
| MW: | 251.16 |
| EINECS: | |
| Product Categories: | |
| Mol File: | 959042-70-7.mol |
|
2-Thiazolamine, 4-(4,5-dichloro-2-thienyl)- Chemical Properties
| Boiling point | 415.4±40.0 °C(Predicted) |
| density | 1.640±0.06 g/cm3(Predicted) |
| pka | 2.94±0.10(Predicted) |
| InChI | InChI=1S/C7H4Cl2N2S2/c8-3-1-5(13-6(3)9)4-2-12-7(10)11-4/h1-2H,(H2,10,11) |
| InChIKey | IGRUEOVREZXPII-UHFFFAOYSA-N |
| SMILES | S1C=C(C2SC(Cl)=C(Cl)C=2)N=C1N |
Safety Information
2-Thiazolamine, 4-(4,5-dichloro-2-thienyl)- Usage And Synthesis
2-Thiazolamine, 4-(4,5-dichloro-2-thienyl)- Preparation Products And Raw materials
