Introduction:Basic information about 3-(Biphenyl-4-yl)-5-(4-tert-butylphenyl)-4-phenyl-4H-1,2,4-triazole CAS 150405-69-9, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
3-(Biphenyl-4-yl)-5-(4-tert-butylphenyl)-4-phenyl-4H-1,2,4-triazole Basic informationApplications
| Product Name: | 3-(Biphenyl-4-yl)-5-(4-tert-butylphenyl)-4-phenyl-4H-1,2,4-triazole |
| Synonyms: | TZA;3-(4-biphenyl)-4-phenyl-5-tert-butylphenyl-1,2,4-triazole/TAZ;3-(Biphenyl-4-yl)-5-(4-tert-butylphenyl)-4-phenyl-4H-1,2,4-triazole 97%;3-([1,1'-biphenyl]-4-yl)-5-(4-(tert-butyl)phenyl)-4-phenyl-4H-1,2,4-triazole;3-(4-tert-butylphenyl)-4-phenyl-5-(4-phenylphenyl)-1,2,4-triazole;3-(BIPHENYL-4-YL)-5-(4-TERT-BUTYLPHENYL)-4H-1,2,4-TRIAZOLE;3-(Biphenyl-4-yl)-5-(4-tert-butylphenyl)-4-phenyl-4H-1,2,4-triazole, 99.5%, purified by sublimation;3-(4-BIPHENYLYL)-4-PHENYL- |
| CAS: | 150405-69-9 |
| MF: | C30H27N3 |
| MW: | 429.56 |
| EINECS: | 623-896-0 |
| Product Categories: | oled materials;OLED |
| Mol File: | 150405-69-9.mol |
|
3-(Biphenyl-4-yl)-5-(4-tert-butylphenyl)-4-phenyl-4H-1,2,4-triazole Chemical Properties
| Melting point | 231-235 °C |
| Boiling point | 611.5±58.0 °C(Predicted) |
| density | 1.08±0.1 g/cm3(Predicted) |
| form | powder/crystals |
| pka | 1.78±0.10(Predicted) |
| color | White |
| InChI | 1S/C30H27N3/c1-30(2,3)26-20-18-25(19-21-26)29-32-31-28(33(29)27-12-8-5-9-13-27)24-16-14-23(15-17-24)22-10-6-4-7-11-22/h4-21H,1-3H3 |
| InChIKey | ZVFQEOPUXVPSLB-UHFFFAOYSA-N |
| SMILES | CC(C)(C)c1ccc(cc1)-c2cc(cc(c2)-c3nc[nH]n3)-c4ccc(cc4)-c5ccccc5 |
| CAS DataBase Reference | 150405-69-9 |
| Absorption | λmax 280 nm?in chloroform |
Safety Information
| Hazard Codes | Xn |
| Risk Statements | 22 |
| WGK Germany | 3 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral |
3-(Biphenyl-4-yl)-5-(4-tert-butylphenyl)-4-phenyl-4H-1,2,4-triazole Usage And Synthesis
| Applications | 1,2,4-triazole-based 3-(biphenyl-4-yl)-5-(4-tertbutylphenyl)-4-phenyl-4H-1,2,4-triazole (TAZ) (ET: 2.7 eV, HOMO/LUMO: 6.3/2.7 eV) has mostly been used in blue phosphorescent OLEDs (PhOLEDs) to serve as an efficient electron-transporting and hole-blocking layer due to its high triplet energy level that would confine the triplet excitons within the emissive layer. The low HOMO/LUMO energy level of TAZ is beneficial for blocking holes and facilitating electron injection/transport, thereby enhancing the device performance. |
| Description | 1,2,4-triazole-based 3-(biphenyl-4-yl)-5-(4-tertbutylphenyl)-4-phenyl-4H-1,2,4-triazole?(TAZ) (ET: 2.7 eV,?HOMO/LUMO: 6.3/2.7 eV) has mostly been used in blue phosphorescent OLEDs (PhOLEDs) to serve as an efficient electron-transporting and hole-blocking layer due to its high triplet energy level that would confine the triplet excitons within the emissive layer. |
| Uses | OLED and QD-LED electron transporter and hole blocker material. |
3-(Biphenyl-4-yl)-5-(4-tert-butylphenyl)-4-phenyl-4H-1,2,4-triazole Preparation Products And Raw materials