Introduction：Basic information about 3-(N-Phenyl-N-methyl)aminoacrolein CAS 14189-82-3, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
3-(N-Phenyl-N-methyl)aminoacrolein Basic information
| Product Name: | 3-(N-Phenyl-N-methyl)aminoacrolein |
| Synonyms: | 3-(N-PHENYL-N-METHYL)AMINOACROLEIN;3-N-METHYL-N-PHENYLAMINOACROLEIN;3-AMINO-N-METHYL-N-PHENYLACROLEIN;3-N-METHYL-N-PHENYLAMINOACROLEINI;3-(methyl(phenyl)amino)acrylaldehyde;N-Methyl-N-phenyl-3-aMinoacrolein;2-Propenal,3-(methylphenylamino)-;(Z)-3-(N-methylanilino)prop-2-enal |
| CAS: | 14189-82-3 |
| MF: | C10H11NO |
| MW: | 161.2 |
| EINECS: | 604-260-1 |
| Product Categories: | Fluvastatin;Fluvastatine |
| Mol File: | 14189-82-3.mol |
|
3-(N-Phenyl-N-methyl)aminoacrolein Chemical Properties
| Melting point | 166 °C (decomp) |
| Boiling point | 144-145 °C(Press: 0.8 Torr) |
| density | 1.064±0.06 g/cm3(Predicted) |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| solubility | Chloroform (Slightly), Ethyl Acetate (Very Slightly) |
| pka | 1.07±0.70(Predicted) |
| form | Solid |
| color | Pale Brown to Brown |
| Stability: | Air Sensitive |
| InChI | InChI=1S/C10H11NO/c1-11(8-5-9-12)10-6-3-2-4-7-10/h2-9H,1H3 |
| InChIKey | YLMOTKLYENPQLK-UHFFFAOYSA-N |
| SMILES | C(=O)C=CN(C)C1=CC=CC=C1 |
| CAS DataBase Reference | 14189-82-3(CAS DataBase Reference) |
Safety Information
3-(N-Phenyl-N-methyl)aminoacrolein Usage And Synthesis
3-(N-Phenyl-N-methyl)aminoacrolein Preparation Products And Raw materials
