Introduction：Basic information about 3-(Trifluoromethoxy)benzyl bromide CAS 159689-88-0, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
3-(Trifluoromethoxy)benzyl bromide Basic information
| Product Name: | 3-(Trifluoromethoxy)benzyl bromide |
| Synonyms: | 1-(Bromomethyl)-3-(trifluoromethoxy)benzene, alpha-Bromo-3-(trifluoromethoxy)toluene;3-(TRIFLUOROMETHOXY)BENZYL BROMIDE;1-(BROMOMETHYL)-3-(TRIFLUOROMETHOXY)BENZENE;alpha-Bromo-3-(trifluoromethoxy)toluene;a-Bromo-3-(trifluoromethoxy)toluene;à-bromo-3-(trifluoromethoxy)toluene;3-(Trifluoromethoxy)benzyl bromide 97%;3-(Trifluoromethoxy)benzylbromide97% |
| CAS: | 159689-88-0 |
| MF: | C8H6BrF3O |
| MW: | 255.03 |
| EINECS: | |
| Product Categories: | Building Blocks;C2 to C8;Chemical Synthesis;Organic Building Blocks;Oxygen Compounds;Fluorine series;Ethers;Organic Building Blocks;Oxygen Compounds |
| Mol File: | 159689-88-0.mol |
|
3-(Trifluoromethoxy)benzyl bromide Chemical Properties
| Boiling point | 179 °C(lit.) |
| density | 1.572 g/mL at 25 °C(lit.) |
| refractive index | n20/D 1.478(lit.) |
| Fp | 192 °F |
| storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C |
| form | clear liquid |
| color | Colorless to Light orange to Yellow |
| Specific Gravity | 1.5838 |
| Sensitive | Lachrymatory |
| BRN | 8052203 |
| InChI | InChI=1S/C8H6BrF3O/c9-5-6-2-1-3-7(4-6)13-8(10,11)12/h1-4H,5H2 |
| InChIKey | QSIVWRRHVXSDNE-UHFFFAOYSA-N |
| SMILES | C1(CBr)=CC=CC(OC(F)(F)F)=C1 |
| CAS DataBase Reference | 159689-88-0(CAS DataBase Reference) |
Safety Information
| Hazard Codes | C |
| Risk Statements | 34 |
| Safety Statements | 26-27-28-36/37/39-45 |
| RIDADR | UN 3265 8/PG 2 |
| WGK Germany | 3 |
| Hazard Note | Corrosive/Lachrymatory |
| HazardClass | 8 |
| PackingGroup | III |
| HS Code | 29093090 |
3-(Trifluoromethoxy)benzyl bromide Usage And Synthesis
| Chemical Properties | Colorless liquid |
| Uses | 3-(Bromomethyl)trifluoromethoxybenzene is a reagent used in the preparation of aminophosphorylalkanoic acid derivatives as aminopeptidase A inhibitors. |
| General Description | 3-(Trifluoromethoxy)benzyl bromide undergoes the Friedel-Crafts polymerization in the presence of aluminum chloride catalyst to afford the polymer. |
3-(Trifluoromethoxy)benzyl bromide Preparation Products And Raw materials
