Introduction：Basic information about 3-(Trifluoromethyl)benzenesulfonamide CAS 672-58-2, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
3-(Trifluoromethyl)benzenesulfonamide Basic information
| Product Name: | 3-(Trifluoromethyl)benzenesulfonamide |
| Synonyms: | 3-(TRIFLUOROMETHYL)BENZENESULFONAMIDE;3-(TRIFLUOROMETHYL)BENZENESULPHONAMIDE;IFLAB-BB F1084-0062;3-Sulphamoylbenzotrifluoride;3-(trifluoromethyl)benzene-1-sulfonamide;3-Sulphamoylbenzotrifluoride, 3-(Aminosulphonyl)benzotrifluoride;Α,Α,Α-Trifluorotoluene-3-Sulfonamide;Benzenesulfonamide, 3-(trifluoromethyl)- |
| CAS: | 672-58-2 |
| MF: | C7H6F3NO2S |
| MW: | 225.19 |
| EINECS: | 640-124-8 |
| Product Categories: | Fluorine series;Building Blocks;Chemical Synthesis;Organic Building Blocks;Sulfur Compounds;Organic Building Blocks;Sulfonamides/Sulfinamides;Sulfur Compounds |
| Mol File: | 672-58-2.mol |
|
3-(Trifluoromethyl)benzenesulfonamide Chemical Properties
| Melting point | 122-126 °C(lit.) |
| Boiling point | 314.3±52.0 °C(Predicted) |
| density | 1.482±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | soluble in Methanol |
| form | powder to crystal |
| pka | 9.69±0.60(Predicted) |
| color | White to Almost white |
| BRN | 2696480 |
| InChI | 1S/C7H6F3NO2S/c8-7(9,10)5-2-1-3-6(4-5)14(11,12)13/h1-4H,(H2,11,12,13) |
| InChIKey | ZUTVRDMZQSHCID-UHFFFAOYSA-N |
| SMILES | NS(=O)(=O)c1cccc(c1)C(F)(F)F |
| CAS DataBase Reference | 672-58-2(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 22 |
| Safety Statements | 22-24/25 |
| RIDADR | 2811 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| PackingGroup | I |
| HS Code | 29350090 |
| Storage Class | 11 - Combustible Solids |
3-(Trifluoromethyl)benzenesulfonamide Usage And Synthesis
3-(Trifluoromethyl)benzenesulfonamide Preparation Products And Raw materials
