Introduction:Basic information about 3,3'-[5'-[3-(3-Pyridinyl)phenyl][1,1':3',1''-terphenyl]-3,3'', including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
Table of Contents
- 1. 3,3'-[5'-[3-(3-Pyridinyl)phenyl][1,1':3',1''-terphenyl]-3,3''-diyl]bispyridine Basic information
- 2. 3,3'-[5'-[3-(3-Pyridinyl)phenyl][1,1':3',1''-terphenyl]-3,3''-diyl]bispyridine Chemical Properties
- 3. Safety Information
- 4. 3,3'-[5'-[3-(3-Pyridinyl)phenyl][1,1':3',1''-terphenyl]-3,3''-diyl]bispyridine Usage And Synthesis
- 5. 3,3'-[5'-[3-(3-Pyridinyl)phenyl][1,1':3',1''-terphenyl]-3,3''-diyl]bispyridine Preparation Products And Raw materials
3,3'-[5'-[3-(3-Pyridinyl)phenyl][1,1':3',1''-terphenyl]-3,3''-diyl]bispyridine Basic information
| Product Name: | 3,3'-[5'-[3-(3-Pyridinyl)phenyl][1,1':3',1''-terphenyl]-3,3''-diyl]bispyridine |
| Synonyms: | 3,3'-[5'-[3-(3-Pyridinyl)phenyl][1,1':3',1''-terphenyl]-3,3''-diyl]bispyridine;TmPyPB;1,3,5-tri[(3-pyridyl)-phen-3-yl]benzene;TMPyPB , 1,3,5-Tri(M-pyrid-3-yl-phenyl)benzene;3,3'-(5'-(3-(pyridin-3-yl)phenyl)-[1,1':3',1''-terphenyl]-3,3''-diyl)dipyridine;TM3PyPB;1,3,5-tri[(3-pyridyl)-phen-3-yl]benzene/TMPyPB;TMPyPB, 1,3,5-tri[(3-pyridyl)-phen-3-yl]benzene |
| CAS: | 921205-03-0 |
| MF: | C39H27N3 |
| MW: | 537.65 |
| EINECS: | 1312995-182-4 |
| Product Categories: | OLED |
| Mol File: | 921205-03-0.mol |
|
3,3'-[5'-[3-(3-Pyridinyl)phenyl][1,1':3',1''-terphenyl]-3,3''-diyl]bispyridine Chemical Properties
| Melting point | 195-200°C |
| Boiling point | 748.9±55.0 °C(Predicted) |
| density | 1.166 |
| storage temp. | 2-8°C |
| solubility | chloroform: soluble dichloromethane: soluble |
| form | powder |
| pka | 5.02±0.11(Predicted) |
| InChI | 1S/C39H27N3/c1-7-28(34-13-4-16-40-25-34)19-31(10-1)37-22-38(32-11-2-8-29(20-32)35-14-5-17-41-26-35)24-39(23-37)33-12-3-9-30(21-33)36-15-6-18-42-27-36/h1-27H |
| InChIKey | CINYXYWQPZSTOT-UHFFFAOYSA-N |
| SMILES | C1(C2=CC(C3=CC=CC(C4=CC=CN=C4)=C3)=CC(C3=CC=CC(C4=CC=CN=C4)=C3)=C2)=CC=CC(C2=CC=CN=C2)=C1 |
| color | White powder/crystals |
| Absorption | λmax?254 nm in DCM |
Safety Information
| WGK Germany | 3 |
| HS Code | 2933399990 |
| Storage Class | 11 - Combustible Solids |
3,3'-[5'-[3-(3-Pyridinyl)phenyl][1,1':3',1''-terphenyl]-3,3''-diyl]bispyridine Usage And Synthesis
| Description | With a low-lying HOMO, high triplet energy level, and electron-deficient pyridine groups, TmPyPB is widely used as an electron-transport layer and hole-blocking layer material in organic electronic devices (such as OLEDs, OPV and perovskite solar cells). |
| Uses | Electron-transport and hole/exciton-blocking materail with high electron mobility (10-4-10-3?cm2?V-1?s-1) and high triplet energy level (2.75 eV) for highly efficient phosphorescent OLEDs application. |
3,3'-[5'-[3-(3-Pyridinyl)phenyl][1,1':3',1''-terphenyl]-3,3''-diyl]bispyridine Preparation Products And Raw materials