Introduction：Basic information about 3,5-Diaminobenzotrifluoride CAS 368-53-6, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
3,5-Diaminobenzotrifluoride Basic information
| Product Name: | 3,5-Diaminobenzotrifluoride |
| Synonyms: | 5-TRIFLUOROMETHYL-1,3-PHENYLENEDIAMIDE;5-(TRIFLUOROMETHYL)-1,3-PHENYLENEDIAMINE;5-TRIFLUOROMETHYL-BENZENE-1,3-DIAMINE;3,5-Diaminobenzotrifluoride 98%;3,5-Diaminobenzotrifluoride98%;35DBTF;3,5-DIAMINOBENZOTRIFLUORIDE;3,5-benzotrifluorodiamine |
| CAS: | 368-53-6 |
| MF: | C7H7F3N2 |
| MW: | 176.14 |
| EINECS: | 206-708-8 |
| Product Categories: | Amines;Nitrogen Compounds;Organic Building Blocks;Polyamines;Trifluoromethylbenzene serise |
| Mol File: | 368-53-6.mol |
|
3,5-Diaminobenzotrifluoride Chemical Properties
| Melting point | 87-89 °C(lit.) |
| Boiling point | 275.0±40.0 °C(Predicted) |
| density | 1.2773 (estimate) |
| storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| pka | 3.66±0.10(Predicted) |
| form | Solid |
| color | Brown |
| BRN | 2966748 |
| InChI | InChI=1S/C7H7F3N2/c8-7(9,10)4-1-5(11)3-6(12)2-4/h1-3H,11-12H2 |
| InChIKey | KZSXRDLXTFEHJM-UHFFFAOYSA-N |
| SMILES | C1(N)=CC(C(F)(F)F)=CC(N)=C1 |
| CAS DataBase Reference | 368-53-6(CAS DataBase Reference) |
| EPA Substance Registry System | 1,3-Benzeneamine, 5-[(trifluoromethyl)- (368-53-6) |
Safety Information
| Hazard Codes | Xn,Xi |
| Risk Statements | 22-41 |
| Safety Statements | 26-39 |
| WGK Germany | 3 |
| RTECS | CZ1606000 |
| Hazard Note | Irritant |
| HazardClass | IRRITANT, IRRITANT-HARMFUL |
| HazardClass | 6.1 |
| HS Code | 2921511990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral
Eye Dam. 1 |
3,5-Diaminobenzotrifluoride Usage And Synthesis
| Uses | 5-(Trifluoromethyl)-1,3-phenylenediamine was used in the synthesis of:
- hybrid materials based on new polyhedral oligomeric silsesquioxane
- fluorinated aromatic polyimide films
|
| Application | 3,5-Diaminotrifluorotoluene is primarily used as a functional monomer in the synthesis of various high-performance materials, especially polymers. A series of fluorinated polyimides can be prepared through polycondensation reactions with various dianhydrides (such as pyromellitic dianhydride). |
3,5-Diaminobenzotrifluoride Preparation Products And Raw materials
| Preparation Products | 3-(1H-imidazol-1-yl)-5-(trifluoromethyl)aniline |
