Introduction:Basic information about CAS 78824-10-9|sodium,4-amino-3,5-dibromobenzenesulfonate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | sodium,4-amino-3,5-dibromobenzenesulfonate |
|---|
| CAS Number | 78824-10-9 | Molecular Weight | 352.96400 |
|---|
| Density | 2.253g/cm3 | Boiling Point | / |
|---|
| Molecular Formula | C6H4Br2NNaO3S | Melting Point | / |
|---|
| MSDS | ChineseUSA | Flash Point | / |
|---|
| Symbol | GHS07 | Signal Word | Warning |
|---|
Names
| Name | sodium,4-amino-3,5-dibromobenzenesulfonate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 2.253g/cm3 |
|---|
| Molecular Formula | C6H4Br2NNaO3S |
|---|
| Molecular Weight | 352.96400 |
|---|
| Exact Mass | 350.81800 |
|---|
| PSA | 91.60000 |
|---|
| LogP | 3.35990 |
|---|
| Index of Refraction | 1.69 |
|---|
| InChIKey | DTJLNZLNWFJAOF-UHFFFAOYSA-M |
|---|
| SMILES | Nc1c(Br)cc(S(=O)(=O)[O-])cc1Br.[Na+] |
|---|
Safety Information
| Symbol | GHS07 |
|---|
| Signal Word | Warning |
|---|
| Hazard Statements | H315-H319-H335 |
|---|
| Precautionary Statements | P261-P305 + P351 + P338 |
|---|
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
|---|
| Hazard Codes | Xi: Irritant; |
|---|
| Risk Phrases | 36/37/38 |
|---|
| Safety Phrases | 26-37/39 |
|---|
| RIDADR | NONH for all modes of transport |
|---|
| HS Code | 2921420090 |
|---|
Customs
| HS Code | 2921420090 |
|---|
| Summary | HS:2921420090 aniline derivatives and their salts VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
|---|
Synonyms
| 4-amino-3,5-dibromobenzenesulphonic acid |
| 2.6-Dibrom-anilin-sulfonsaeure-(4) |
| 4-Amino-3,5-dibromobenzenesulfonic acid sodium salt |
| 4-Amino-3,5-dibrom-benzolsulfonsaeure |
| 4-amino-3,5-dibromo-benzenesulfonic acid |
| 3,5-dibromosulfanilic acid |
| 3,5-dibromosulphanilic acid |
| MFCD00007640 |