Introduction：Basic information about 3,5-Dichloro-4-fluorobenzotrifluoride CAS 77227-81-7, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
3,5-Dichloro-4-fluorobenzotrifluoride Basic information
| Product Name: | 3,5-Dichloro-4-fluorobenzotrifluoride |
| Synonyms: | 3,5-DICHLORO-ALPHA,ALPHA,ALPHA-4-TETRAFLUOROTOLUENE;3,5-dichloro-4-fluoro-alpha,alpha,alpha-trifluorotoluene;1,3-DICHLORO-2-FLUORO-5-(TRIFLUOROMETHYL)BENZENE;3,5-DICHLORO-4-FLUOROBENZOTRIFLUORIDE;3,5-Dichloro-4-fluoronitrobezene;3,5-dichloro-4- chlorobenzotrifluoride;Benzene, 1,3-dichloro-2-fluoro-5-(trifluoromethyl)-;3,5-Dichloro-4-fluorobenzotrifluoride 98% |
| CAS: | 77227-81-7 |
| MF: | C7H2Cl2F4 |
| MW: | 232.99 |
| EINECS: | 620-878-4 |
| Product Categories: | Aryl;C7;Halogenated Hydrocarbons;Aryl Fluorinated Building Blocks;Building Blocks;Chemical Synthesis;Fluorinated Building Blocks;Halogenated Hydrocarbons;Organic Building Blocks;Organic Fluorinated Building Blocks;Other Fluorinated Organic Building Blocks |
| Mol File: | 77227-81-7.mol |
|
3,5-Dichloro-4-fluorobenzotrifluoride Chemical Properties
| Boiling point | 166-168 °C (lit.) |
| density | 1.555 g/mL at 25 °C (lit.) |
| refractive index | n20/D 1.462(lit.) |
| Fp | 164 °F |
| storage temp. | Storage temp. 2-8°C |
| form | liquid |
| color | Clear |
| BRN | 6199573 |
| InChI | 1S/C7H2Cl2F4/c8-4-1-3(7(11,12)13)2-5(9)6(4)10/h1-2H |
| InChIKey | BWQFQKZDLBJZAW-UHFFFAOYSA-N |
| SMILES | Fc1c(Cl)cc(cc1Cl)C(F)(F)F |
| CAS DataBase Reference | 77227-81-7(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xn,Xi |
| Risk Statements | 22-41 |
| Safety Statements | 26-36 |
| RIDADR | UN 2810 6.1/PG 3 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29039990 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3
toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Oral
Eye Dam. 1 |
3,5-Dichloro-4-fluorobenzotrifluoride Usage And Synthesis
| Chemical Properties | CLEAR LIGHT YELLOW LIQUID |
| Uses | 3,5-Dichloro-4-fluorobenzotrifluoride may be used for the synthesis of 3-[4-[1-(2,6-dichloro-3-iodo-4-trifluoromethylphenyl)-5-iodopyrazolo]]-3-(trifluoromethyl)diazirine. |
| General Description | 3,5-Dichloro-4-fluorobenzotrifluoride is an aryl fluorinated building block. |
| Synthesis | In a 1L three-necked reaction flask equipped with a stirrer, reflux condenser and temperature ground, 200 g of 3,4,5-trichlorobenzotrifluoride and 200 g of potassium fluoride and 500 ml of cyclobutanesulfone were added, then heated to 190??C, kept warm and stirred for 20 hours and then cooled down to 100??C. 200 g of the crude product (containing about 10% of the cyclobutanesulfone) was evaporated under 0.01 MPa pressure. Then the temperature was raised to 150 ?? and the pressure was reduced to recover the cyclobutanesulfone (can be directly used in the next batch of reaction). 200 g of crude 3,5-dichloro-4-fluorobenzotrifluoride was directly used in the next step of the ammoniation reaction. |
3,5-Dichloro-4-fluorobenzotrifluoride Preparation Products And Raw materials
| Preparation Products | 3-Chloro-4,5-difluorobenzotrifluoride |
