Introduction：Basic information about 3,5-Dinitrobenzoyl chloride CAS 99-33-2, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
3,5-Dinitrobenzoyl chloride Basic information
| Product Name: | 3,5-Dinitrobenzoyl chloride |
| Synonyms: | 3,5-Dinitrobenzoicchloride;3,5-dinitrobenzoyl;3,5-dinitro-benzoylchlorid;DNBC;3,5-DINITROBENZOYL CHLORIDE;3,5-dinitrobenzoic acid chloride;3,4-DINITROBENZOYL CHLORIDE;3,5-DINITROBENZOYL CHLORIDE, FOR FLUORES CENCE |
| CAS: | 99-33-2 |
| MF: | C7H3ClN2O5 |
| MW: | 230.56 |
| EINECS: | 202-750-6 |
| Product Categories: | API intermediates;Amino Group Labeling Reagents for HPLC;Hydroxyl Group Labeling Reagents for HPLC;Analytical Chemistry;HPLC Labeling Reagents;UV Detection (HPLC Labeling Reagents) |
| Mol File: | 99-33-2.mol |
|
3,5-Dinitrobenzoyl chloride Chemical Properties
| Melting point | 68-69 °C(lit.) |
| Boiling point | 196 °C11 mm Hg(lit.) |
| density | 1.8836 (rough estimate) |
| vapor density | 7.6 (vs air) |
| refractive index | 1.6290 (estimate) |
| Fp | 196°C/12mm |
| storage temp. | 2-8°C |
| solubility | Chloroform (Slightly), Ethyl Acetate (Slightly) |
| form | Crystals or Crystalline Needles |
| color | Yellow to beige |
| Water Solubility | Slightly soluble in water. |
| Sensitive | Moisture Sensitive |
| Merck | 14,3277 |
| BRN | 990249 |
| Stability: | Stable. Incompatible with strong oxidizing agents, water, moisture, nitrates, combustible material. Refrigerate. |
| InChI | 1S/C7H3ClN2O5/c8-7(11)4-1-5(9(12)13)3-6(2-4)10(14)15/h1-3H |
| InChIKey | NNOHXABAQAGKRZ-UHFFFAOYSA-N |
| SMILES | [O-][N+](=O)c1cc(cc(c1)[N+]([O-])=O)C(Cl)=O |
| CAS DataBase Reference | 99-33-2(CAS DataBase Reference) |
| NIST Chemistry Reference | Benzoyl chloride, 3,5-dinitro-(99-33-2) |
| EPA Substance Registry System | Benzoyl chloride, 3,5-dinitro- (99-33-2) |
Safety Information
| Hazard Codes | C |
| Risk Statements | 34 |
| Safety Statements | 26-36/37/39-45-25 |
| RIDADR | UN 3261 8/PG 2 |
| WGK Germany | 3 |
| RTECS | DM6637000 |
| F | 21 |
| Hazard Note | Corrosive |
| TSCA | TSCA listed |
| HazardClass | 8 |
| PackingGroup | II |
| HS Code | 29163900 |
| HS Code | 29400090 |
| Storage Class | 8A - Combustible corrosive hazardous materials |
| Hazard Classifications | Skin Corr. 1B |
3,5-Dinitrobenzoyl chloride Usage And Synthesis
| Chemical Properties | yellow-brown solid |
| Uses | 3,5-dinitrobenzoyl chloride is an important intermediate for organic synthesis. |
| Uses | Used in photography. This aromatic compound is used by chemists to identify alcohol components in esters and in the fluorometric analysis of creatinine. |
| Purification Methods | Crystallise it from CCl4 or pet ether (b 40-60o). It reacts readily with H2O and should be kept in sealed ampoules. [Beilstein 9 IV 1350.] |
3,5-Dinitrobenzoyl chloride Preparation Products And Raw materials
| Raw materials | Thionyl chloride-->Carbon tetrachloride-->3,5-Dinitrobenzoic acid |
| Preparation Products | (+)-DISPARLURE-->Vitamin D2-->SAPERCONAZOLE-->3,5-DINITROBENZALDEHYDE-->(S)-(+)-N-(3,5-DINITROBENZOYL)-ALPHA-PHENYLGLYCINE |
