Introduction：Basic information about 3-Amino-3-phenylpropionic acid CAS 614-19-7, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
3-Amino-3-phenylpropionic acid Basic information
| Product Name: | 3-Amino-3-phenylpropionic acid |
| Synonyms: | 2-Amino-2-phenylpropansαure;Benzenepropanoicacid,βamino-;Benzenepropanoicacid,β-amino-,(±)-;DL-3-Amino-3-phenylpropionsαure;3-(PHENYLAMINO)PROPANOIC ACID;3-PHENYLAMINO-PROPIONIC ACID;beta-phenyl-beta-alanine;DL-beta-Homophenylglycine |
| CAS: | 614-19-7 |
| MF: | C9H11NO2 |
| MW: | 165.19 |
| EINECS: | 210-371-2 |
| Product Categories: | Amino Acids and Derivatives;Benzene series;B-Amino;Organic acids;Pyridines |
| Mol File: | 614-19-7.mol |
|
3-Amino-3-phenylpropionic acid Chemical Properties
| Melting point | 222 °C (dec.)(lit.) |
| Boiling point | 293.03°C (rough estimate) |
| density | 1.1603 (rough estimate) |
| refractive index | 1.5200 (estimate) |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| pka | 3.45±0.12(Predicted) |
| form | Solid |
| color | White to Almost white |
| Water Solubility | SOLUBLE |
| BRN | 2803286 |
| Major Application | peptide synthesis |
| InChI | InChI=1S/C9H11NO2/c10-8(6-9(11)12)7-4-2-1-3-5-7/h1-5,8H,6,10H2,(H,11,12) |
| InChIKey | UJOYFRCOTPUKAK-UHFFFAOYSA-N |
| SMILES | C(C1C=CC=CC=1)(N)CC(=O)O |
| LogP | 0.211 (est) |
| CAS DataBase Reference | 614-19-7(CAS DataBase Reference) |
Safety Information
| Risk Statements | 36/37/38 |
| Safety Statements | 24/25-37/39 |
| WGK Germany | 3 |
| HS Code | 29163990 |
| Storage Class | 11 - Combustible Solids |
3-Amino-3-phenylpropionic acid Usage And Synthesis
| Chemical Properties | white crystalline powder |
| Uses | DL-β-Phenylalanine is a useful synthetic intermediate. It was used in the synthesis of platelet aggregation inhibitors. It was also used as a reagent to synthesize human gonadotropin-releasing hormone receptor antagonists |
| Definition | ChEBI: 3-amino-3-phenylpropanoic acid is a beta-amino acid that is beta-alanine substituted at position 3 by a phenyl group. It is a tautomer of a 3-ammonio-3-phenylpropanoate. |
| Synthesis Reference(s) | Chemical and Pharmaceutical Bulletin, 27, p. 2223, 1979 DOI: 10.1248/cpb.27.2223 |
| reaction suitability | reaction type: solution phase peptide synthesis |
3-Amino-3-phenylpropionic acid Preparation Products And Raw materials
