Introduction:Basic information about CAS 251446-38-5|3-amino-N-(4-fluorophenyl)benzamide, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 3-amino-N-(4-fluorophenyl)benzamide |
|---|
| CAS Number | 251446-38-5 | Molecular Weight | 230.23800 |
|---|
| Density | 1.317g/cm3 | Boiling Point | 321.9ºC at 760 mmHg |
|---|
| Molecular Formula | C13H11FN2O | Melting Point | / |
|---|
| MSDS | / | Flash Point | 148.5ºC |
|---|
Names
| Name | 3-amino-N-(4-fluorophenyl)benzamide |
|---|
Chemical & Physical Properties
| Density | 1.317g/cm3 |
|---|
| Boiling Point | 321.9ºC at 760 mmHg |
|---|
| Molecular Formula | C13H11FN2O |
|---|
| Molecular Weight | 230.23800 |
|---|
| Flash Point | 148.5ºC |
|---|
| Exact Mass | 230.08600 |
|---|
| PSA | 55.12000 |
|---|
| LogP | 3.31440 |
|---|
| Vapour Pressure | 0.000289mmHg at 25°C |
|---|
| Index of Refraction | 1.666 |
|---|
| InChIKey | UQDXYYVYLAFUPG-UHFFFAOYSA-N |
|---|
| SMILES | Nc1cccc(C(=O)Nc2ccc(F)cc2)c1 |
|---|