Introduction:Basic information about 3-bromo-5-(tert-butyl)benzo[b]thiophene CAS 1780644-81-6, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
3-bromo-5-(tert-butyl)benzo[b]thiophene Basic information
| Product Name: | 3-bromo-5-(tert-butyl)benzo[b]thiophene |
| Synonyms: | 3-bromo-5-(tert-butyl)benzo[b]thiophene;Benzo[b]thiophene, 3-bromo-5-(1,1-dimethylethyl)-;3-?bromo-?5-?tert-?butyl-?1-?benzothiophene;3-bromo-5-tert-butylbenzothiophene |
| CAS: | 1780644-81-6 |
| MF: | C12H13BrS |
| MW: | 269.2 |
| EINECS: | |
| Product Categories: | |
| Mol File: | 1780644-81-6.mol |
|
3-bromo-5-(tert-butyl)benzo[b]thiophene Chemical Properties
| Boiling point | 327.7±22.0 °C(Predicted) |
| density | 1.374±0.06 g/cm3(Predicted) |
| storage temp. | Storage temp. 2-8°C |
| Appearance | Colorless to light yellow Liquid |
| InChI | InChI=1S/C12H13BrS/c1-12(2,3)8-4-5-11-9(6-8)10(13)7-14-11/h4-7H,1-3H3 |
| InChIKey | TUVDJRXZHABERX-UHFFFAOYSA-N |
| SMILES | C12=CC=C(C(C)(C)C)C=C1C(Br)=CS2 |
Safety Information
3-bromo-5-(tert-butyl)benzo[b]thiophene Usage And Synthesis
| Uses | 3-bromo-5-(tert-butyl)benzo[b]thiophene is an important organic reagent that can be used as a building block for the synthesis of many organic compounds, such as 5-(1,1-dimethylethyl)-N-[4-(1,1-dimethylethyl)phenyl]-Benzo[b]thiophen-3-amine and so on. |
| Application | 3-bromo-5-(tert-butyl)benzo[b]thiophene can be applied to luminescent materials such as organic light-emitting device materials and polycyclic aromatic compounds. |
| Hazard | 3-bromo-5-(tert-butyl)benzo[b]thiophene causes skin irritation and serious eye irritation. It is harmful if swallowed. |
3-bromo-5-(tert-butyl)benzo[b]thiophene Preparation Products And Raw materials