Introduction：Basic information about 3-BROMO-5-CHLOROBENZOIC ACID CAS 42860-02-6, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
3-BROMO-5-CHLOROBENZOIC ACID Basic information
| Product Name: | 3-BROMO-5-CHLOROBENZOIC ACID |
| Synonyms: | 3-BROMO-5-CHLOROBENZOIC ACID;CBPA;3-Bromo-5-chlorobenzoic acid 98%;Benzoic acid,3-broMo-5-chloro-;3-Bromo-5-chlorobenzoic Acid >3-BROMO-5-CHLOROBENZOIC ACID ISO 9001：2015 REACH |
| CAS: | 42860-02-6 |
| MF: | C7H4BrClO2 |
| MW: | 235.46 |
| EINECS: | |
| Product Categories: | Benzoic acid series;Acids & Esters;blocks;Bromides;Bromine Compounds;Chlorine Compounds;Carboxes |
| Mol File: | 42860-02-6.mol |
|
3-BROMO-5-CHLOROBENZOIC ACID Chemical Properties
| Melting point | 190-192 |
| Boiling point | 332.0±27.0 °C(Predicted) |
| density | 1.809 |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | soluble in Methanol |
| form | powder to crystal |
| pka | 3.44±0.10(Predicted) |
| color | White to Light yellow |
| InChI | InChI=1S/C7H4BrClO2/c8-5-1-4(7(10)11)2-6(9)3-5/h1-3H,(H,10,11) |
| InChIKey | PBRRUJWXRUGGAW-UHFFFAOYSA-N |
| SMILES | C(O)(=O)C1=CC(Cl)=CC(Br)=C1 |
| CAS DataBase Reference | 42860-02-6 |
Safety Information
| Hazard Codes | Xi |
| Hazard Note | Harmful/Irritant/Keep Cold |
| HS Code | 2916399090 |
3-BROMO-5-CHLOROBENZOIC ACID Usage And Synthesis
| Chemical Properties | off-white solid |
| Uses | 3-Bromo-5-chlorobenzoic acid, as an aromatic bromic acid, can be used to synthesize inhibitors of phosphodiesterase PDE4 and cholinergic receptors (mACHRs), and can also be used to synthesize drugs for the treatment of type 2 diabetes. |
3-BROMO-5-CHLOROBENZOIC ACID Preparation Products And Raw materials
