Introduction:Basic information about 3-Chloro-4-(pyridin-3-yl)-1,2,5-thiadiazole CAS 131986-28-2, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
3-Chloro-4-(pyridin-3-yl)-1,2,5-thiadiazole Basic information
| Product Name: | 3-Chloro-4-(pyridin-3-yl)-1,2,5-thiadiazole |
| Synonyms: | 3-CHLORO-4-(PYRIDIN-3-YL)-1,2,5-THIADIAZOLE;3-(4-CHLORO-1,2,5-THIADIAZOL-3-YL)PYRIDINE;3-Chloro-4-(3-pyridyl)-1,2,5-thiadiazole, 95%;Pyridine, 3-(4-chloro-1,2,5-thiadiazol-3-yl)-;3-(3-chloro-1,2,5-thiadiazol-4yl)pyridine;3-Chloro-4-(3-pyridyl)-1,2,5-thiadiazole,95%;Xanomeline intermediate 1;3-Chloro-4-(3-pyridyl)-1,2,5-thiadiazole |
| CAS: | 131986-28-2 |
| MF: | C7H4ClN3S |
| MW: | 197.64 |
| EINECS: | 681-123-2 |
| Product Categories: | |
| Mol File: | 131986-28-2.mol |
|
3-Chloro-4-(pyridin-3-yl)-1,2,5-thiadiazole Chemical Properties
| Melting point | 56℃ |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| form | solid |
| InChI | InChI=1S/C7H4ClN3S/c8-7-6(10-12-11-7)5-2-1-3-9-4-5/h1-4H |
| InChIKey | CMPNWGQBNRHIQZ-UHFFFAOYSA-N |
| SMILES | C1=NC=CC=C1C1C(Cl)=NSN=1 |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 41 |
| Safety Statements | 26-39 |
| WGK Germany | WGK 3 |
| HazardClass | IRRITANT |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Oral Eye Dam. 1 |
3-Chloro-4-(pyridin-3-yl)-1,2,5-thiadiazole Usage And Synthesis
| Chemical Properties | White to cream. |
| Uses | 3-Chloro-4-(pyridin-3-yl)-1,2,5-thiadiazole can be used to treat neurological disorders. |
| Definition | ChEBI: 3-Chloro-4-(pyridin-3-yl)-1,2,5-thiadiazole is a member of pyridines. |
3-Chloro-4-(pyridin-3-yl)-1,2,5-thiadiazole Preparation Products And Raw materials