Introduction：Basic information about 3-Ethoxy-4-ethoxycarbonyl phenylacetic acid CAS 99469-99-5, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
3-Ethoxy-4-ethoxycarbonyl phenylacetic acid Basic information
| Product Name: | 3-Ethoxy-4-ethoxycarbonyl phenylacetic acid |
| Synonyms: | Repaglinide Related CoMpound B;3-Ethoxy-4-ethoxycar;2-[3-ethoxy-4-(ethoxycarbonyl)phenyl]acetic acid;IMp. B (EP): [3-Ethoxy-4-(ethoxycarbonyl)-phenyl]acetic Acid;4-Ethoxycaybonyl-3-ethoxyphenylacetic acid;4-CarboxyMethyl-2-ethoxy-benzoic acid ethyl ester;Repaglinide EP IMpurity B;4-Ethoxycarbonyl-3-ethoxyphenylacetic acid, >=99% |
| CAS: | 99469-99-5 |
| MF: | C13H16O5 |
| MW: | 252.26 |
| EINECS: | 427-630-2 |
| Product Categories: | Pharmaceutical material and intermeidates;Aromatics;Aromatic Phenylacetic Acids and Derivatives |
| Mol File: | 99469-99-5.mol |
|
3-Ethoxy-4-ethoxycarbonyl phenylacetic acid Chemical Properties
| Melting point | 78-80°C |
| Boiling point | 414.8±35.0 °C(Predicted) |
| density | 1.191 |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| pka | 3.96±0.10(Predicted) |
| color | White to Off-White |
| Major Application | pharmaceutical (small molecule) |
| InChI | InChI=1S/C13H16O5/c1-3-17-11-7-9(8-12(14)15)5-6-10(11)13(16)18-4-2/h5-7H,3-4,8H2,1-2H3,(H,14,15) |
| InChIKey | OTGSESBEJUHCES-UHFFFAOYSA-N |
| SMILES | C1(CC(O)=O)=CC=C(C(OCC)=O)C(OCC)=C1 |
| CAS DataBase Reference | 99469-99-5(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 41 |
| Safety Statements | 26-39 |
| RIDADR | UN3261 |
| WGK Germany | WGK 3 |
| HazardClass | 8 |
| HS Code | 2918992090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Dam. 1 |
3-Ethoxy-4-ethoxycarbonyl phenylacetic acid Usage And Synthesis
| Chemical Properties | White to Pale Yellow Solid |
| Uses | Repaglinide intermediate. |
3-Ethoxy-4-ethoxycarbonyl phenylacetic acid Preparation Products And Raw materials
| Preparation Products | (+)-2-Ethoxy-4-(N-3-Methyl-1(S)-(2-(1-Piperidinyl)Phenyl)-Butyl)Carbamoylmethyl) |
