Introduction：Basic information about 3DPAFIPN CAS 2260543-73-3, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
3DPAFIPN Basic information
| Product Name: | 3DPAFIPN |
| Synonyms: | 3DPAFIPN;1,3-Benzenedicarbonitrile, 2,4,6-tris(diphenylamino)-5-fluoro-;2,4,6-Tris(diphenylamino)-5-fluoroisophthalonitrile |
| CAS: | 2260543-73-3 |
| MF: | C44H30FN5 |
| MW: | 647.74 |
| EINECS: | |
| Product Categories: | |
| Mol File: | 2260543-73-3.mol |
|
3DPAFIPN Chemical Properties
| Melting point | 307-401 °C |
| Boiling point | 806.2±65.0 °C(Predicted) |
| density | 1.33±0.1 g/cm3(Predicted) |
| storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C |
| form | powder |
| pka | -7.10±0.50(Predicted) |
| Appearance | Light yellow to yellow Solid |
| InChIKey | GCGRXVMGBHYMDA-UHFFFAOYSA-N |
| SMILES | C1(C#N)=C(N(C2=CC=CC=C2)C2=CC=CC=C2)C(F)=C(N(C2=CC=CC=C2)C2=CC=CC=C2)C(C#N)=C1N(C1=CC=CC=C1)C1=CC=CC=C1 |
Safety Information
| WGK Germany | WGK 3 |
| Storage Class | 11 - Combustible Solids |
3DPAFIPN Usage And Synthesis
| Uses | 3DPAFIPN is cyanoarene-based donor-acceptor photocatalyst developed by the Zeitler group. |
| reaction suitability | reaction type: Photocatalysis
reagent type: catalyst |
3DPAFIPN Preparation Products And Raw materials
