Introduction：Basic information about 3-Hydroxy-1,2,3-benzotriazin-4(3H)-one CAS 28230-32-2, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
3-Hydroxy-1,2,3-benzotriazin-4(3H)-one Basic information
| Product Name: | 3-Hydroxy-1,2,3-benzotriazin-4(3H)-one |
| Synonyms: | 3-hydroxy-3,4-dihydrobenzotriazine-4-one;3-Hydroxy-1,2,3-ben zotriazin-4(3H)-one(HOOBT);3-HYDROXY-4-KETOBENZOTRIAZINE;3-HYDROXY-3,4-DIHYDRO-4-OXO-1,2,3-BENZOTRIAZINE;3-HYDROXY-[1,2,3]BENZOTRIAZIN-4(3H)-ON;3-HYDROXY-1,2,3-BENZOTRIAZIN-4(3H)-ONE;3-HYDROXY-1,2,3-BENZOTRIAZIN-4-ONE;3-HYDROXY-1,2,3-BENZOTRIAZINE 4(3H)-ONE |
| CAS: | 28230-32-2 |
| MF: | C7H5N3O2 |
| MW: | 163.13 |
| EINECS: | 248-916-1 |
| Product Categories: | Peptide;Peptide Coupling Reagents |
| Mol File: | 28230-32-2.mol |
|
3-Hydroxy-1,2,3-benzotriazin-4(3H)-one Chemical Properties
| Melting point | 184-189°C |
| Boiling point | 290.19°C (rough estimate) |
| density | 1.041(20.0000℃) |
| refractive index | n20/D 1.476 |
| Fp | 58 °C |
| storage temp. | 2-8°C |
| solubility | Soluble in water or 1% acetic acid |
| pka | 7.78±0.20(Predicted) |
| form | Powder |
| color | White to off-white |
| InChI | InChI=1S/C7H5N3O2/c11-7-5-3-1-2-4-6(5)8-9-10(7)12/h1-4,12H |
| InChIKey | HJBLUNHMOKFZQX-UHFFFAOYSA-N |
| SMILES | N1C2=CC=CC=C2C(=O)N(O)N=1 |
| CAS DataBase Reference | 28230-32-2(CAS DataBase Reference) |
Safety Information
| Hazard Codes | T,E,Xi |
| Risk Statements | 20/21-36/37/38-2-1-61 |
| Safety Statements | 53-26-35-36/37-45-37/39-36 |
| RIDADR | UN 3379 3/PG 1 |
| WGK Germany | 3 |
| F | 10-21 |
| HS Code | 29339900 |
3-Hydroxy-1,2,3-benzotriazin-4(3H)-one Usage And Synthesis
| Chemical Properties | Slightly yellow crystals |
| Uses | Used as additive to improve yields and decrease racemization in DCC-promoted peptide synthesis. |
| Synthesis Reference(s) | Synthesis, p. 1008, 1990 DOI: 10.1055/s-1990-27078 |
| Synthesis | 3-Hydroxy-1,2,3-benzotriazin-4(3H)-one is prepared by ?reaction of Sodium Nitrite with o-aminobenzhydroxamic acid. |
| storage | Store at -20°C |
3-Hydroxy-1,2,3-benzotriazin-4(3H)-one Preparation Products And Raw materials
| Preparation Products | DEPBT-->THYMINE-1-ACETIC ACID-->Fmoc-Gly-ODhbt |
