Introduction:Basic information about 3-Methacrylamidopropyl Tris(Trimethylsiloxy)Silane CAS 115257-95-9, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
3-Methacrylamidopropyl Tris(Trimethylsiloxy)Silane Basic information
| Product Name: | 3-Methacrylamidopropyl Tris(Trimethylsiloxy)Silane |
| Synonyms: | 3-Methacrylamidopropyl Tris(Trimethylsiloxy)Silane;Tris(trimethylsiloxy)silylpropylmethacrylamide;2-Propenamide, 2-methyl-N-[3-[3,3,3-trimethyl-1,1-bis[(trimethylsilyl)oxy]-1-disiloxanyl]propyl]-;3-Methacrylamidopropyltris(trimethylsiloxy)silane >95%, stabilized with 4-Methoxyphenol, 50-500 ppm;N-(3-(1,1,1,5,5,5-Hexamethyl-3-((Trimethylsilyl)Oxy)Trisiloxan-3-Yl)Propyl)Methacrylamide;DKFELEX0302 |
| CAS: | 115257-95-9 |
| MF: | C16H39NO4Si4 |
| MW: | 421.83 |
| EINECS: | |
| Product Categories: | |
| Mol File: | 115257-95-9.mol |
|
3-Methacrylamidopropyl Tris(Trimethylsiloxy)Silane Chemical Properties
| Boiling point | 130-133°C / 0.5 |
| density | 0.926±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| pka | 15.01±0.46(Predicted) |
| form | liquid |
| Hydrolytic Sensitivity | 4: no reaction with water under neutral conditions |
| InChI | InChI=1S/C16H39NO4Si4/c1-15(2)16(18)17-13-12-14-25(19-22(3,4)5,20-23(6,7)8)21-24(9,10)11/h1,12-14H2,2-11H3,(H,17,18) |
| InChIKey | IHNDNMHBSSSIPV-UHFFFAOYSA-N |
| SMILES | C(NCCC[Si](O[Si](C)(C)C)(O[Si](C)(C)C)O[Si](C)(C)C)(=O)C(C)=C |
Safety Information
| WGK Germany | WGK 3 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
3-Methacrylamidopropyl Tris(Trimethylsiloxy)Silane Usage And Synthesis
| Uses | This monomer is commonly used in the formulation of research silicone hydrogel contact lenses and other research ophthalmic devices. Silicone monomers are preferred for the synthesis of research ophthalmic materials due to their high oxygen permeability. |
3-Methacrylamidopropyl Tris(Trimethylsiloxy)Silane Preparation Products And Raw materials