Introduction：Basic information about 3-Methacryloxypropylmethyldimethoxysilane CAS 14513-34-9, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
3-Methacryloxypropylmethyldimethoxysilane Basic information
| Product Name: | 3-Methacryloxypropylmethyldimethoxysilane |
| Synonyms: | 3-(dimethoxymethylsilyl)propyl methacrylate;3-METHACRYLOXYPROPYLMETHYLDIMETHOXY SILANE;gamma-Methacryloxypropylmethyldimethoxysilane;METHACRYLOXYPROPYLMETHYLDIMETHOXYSILANE 95+%;3-METHACRYLOXYPROPYLMETHYLDIMETHOXY SILANE(KH571);Methacryloxypropylmethyldimethoxysilane(inhibitedwithMEHQ);(3-Methyldimethoxysilyl)propylmethacylate;Methacryloxypropylmethyl dimethoxysilane 3-methacryloxypropylmethyldimethoxysilane |
| CAS: | 14513-34-9 |
| MF: | C10H20O4Si |
| MW: | 232.35 |
| EINECS: | 238-518-6 |
| Product Categories: | Methacrylate Silanes;Acrylate;top |
| Mol File: | 14513-34-9.mol |
|
3-Methacryloxypropylmethyldimethoxysilane Chemical Properties
| Boiling point | 65 °C |
| density | 1 |
| vapor pressure | 0.001-12790Pa at 20-25℃ |
| refractive index | 1.433 |
| Fp | 88°C |
| storage temp. | Inert atmosphere,Room Temperature |
| form | clear liquid |
| Specific Gravity | 1.0 |
| color | Colorless to Almost colorless |
| Odor | Mild odor |
| Water Solubility | 240-1000000mg/L at 20℃ |
| Hydrolytic Sensitivity | 7: reacts slowly with moisture/water |
| InChI | InChI=1S/C10H20O4Si/c1-8(2)9(11)14-6-5-7-15-10(12-3)13-4/h10H,1,5-7,15H2,2-4H3 |
| InChIKey | VLZDYNDUVLBNLD-UHFFFAOYSA-N |
| SMILES | C(OCCC[SiH2]C(OC)OC)(=O)C(C)=C |
| LogP | -0.82-3.4 at 20℃ |
| CAS DataBase Reference | 14513-34-9(CAS DataBase Reference) |
Safety Information
| Risk Statements | 20/21/22-36/37/38 |
| Safety Statements | 23-36/37/39 |
| TSCA | No |
| HS Code | 2931.90.9010 |
3-Methacryloxypropylmethyldimethoxysilane Usage And Synthesis
| Chemical Properties | Clear to straw liquid with mild odor |
| Uses | 3-Methacryloxypropylmethyldimethoxysilane is used as adhesion promoter at organic/inorgainc interfaces, as surface modifier (e.g. imparting water repellency, organophilic surface adjustment) or as crosslinking of polymers). It is used as a coupling agent to improve the physical and electrical properties of glass-reinforced and mineral-filled thermosetting resins under exposure to heat and/or moisture. |
| Flammability and Explosibility | Not classified |
3-Methacryloxypropylmethyldimethoxysilane Preparation Products And Raw materials
| Raw materials | Allyl methacrylate-->3-Chloropropylmethyldimethoxysilane-->Methyldimethoxysilane-->POTASSIUM METHACRYLATE-->SODIUM METHACRYLATE-->Methacrylic acid |
