3-Methyl-2-butenoic acid (9R,10R)-10-acetoxy-9,10-dihydro-8,8-dimethyl-2-oxo-2H,8H-benzo[1,2-b:3,4-b
Introduction:Basic information about 3-Methyl-2-butenoic acid (9R,10R)-10-acetoxy-9,10-dihydro-8,8-dimethyl-2-oxo-2H,8H-benzo[1,2-b:3,4-b, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
3-Methyl-2-butenoic acid (9R,10R)-10-acetoxy-9,10-dihydro-8,8-dimethyl-2-oxo-2H,8H-benzo[1,2-b:3,4-b']dipyran-9-yl ester Basic information
| Product Name: | 3-Methyl-2-butenoic acid (9R,10R)-10-acetoxy-9,10-dihydro-8,8-dimethyl-2-oxo-2H,8H-benzo[1,2-b:3,4-b']dipyran-9-yl ester |
| Synonyms: | 3-Methyl-2-butenoic acid (9R,10R)-10-acetoxy-9,10-dihydro-8,8-dimethyl-2-oxo-2H,8H-benzo[1,2-b:3,4-b']dipyran-9-yl ester;Samidin;]dipyran-9-yl ester;2-Butenoic acid, 3-methyl-, (9R,10R)-10-(acetyloxy)-9,10-dihydro-8,8-dimethyl-2-oxo-2H,8H-benzo[1,2-b:3,4-b']dipyran-9-yl ester;(+)-Samidin;10-Acetoxy-8,8-dimethyl-2-oxo-9,10-dihydro-2H,8H-pyrano[2,3-f]chromen-9-yl3-methyl-2-butenoate |
| CAS: | 477-33-8 |
| MF: | C21H22O7 |
| MW: | 386.4 |
| EINECS: | 225-472-7 |
| Product Categories: | Aromatics;Chiral Reagents;Heterocycles;Intermediates & Fine Chemicals;Pharmaceuticals |
| Mol File: | 477-33-8.mol |
3-Methyl-2-butenoic acid (9R,10R)-10-acetoxy-9,10-dihydro-8,8-dimethyl-2-oxo-2H,8H-benzo[1,2-b:3,4-b']dipyran-9-yl ester Chemical Properties
| Boiling point | 486.8±45.0 °C(Predicted) |
| density | 1.28±0.1 g/cm3(Predicted) |
| storage temp. | -20°C |
| solubility | Chloroform (Slightly), Ethyl Acetate (Slightly) |
| form | Solid |
| color | White |
| Major Application | metabolomics vitamins, nutraceuticals, and natural products |
| InChI | 1S/C21H22O7/c1-11(2)10-16(24)27-20-19(25-12(3)22)17-14(28-21(20,4)5)8-6-13-7-9-15(23)26-18(13)17/h6-10,19-20H,1-5H3/t19-,20-/m1/s1 |
| InChIKey | FNVCLGWRMXTDSM-WOJBJXKFSA-N |
| SMILES | C\C(C)=C\C(=O)O[C@@H]1[C@H](OC(C)=O)c2c(OC1(C)C)ccc3C=CC(=O)Oc23 |
Safety Information
| Hazard Codes | Xn,N |
| Risk Statements | 22-50 |
| Safety Statements | 61 |
| RIDADR | UN 3077 9 / PGIII |
| WGK Germany | 3 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Aquatic Acute 1 Aquatic Chronic 1 |
| Uses | A potent vasodilatory agent isolated from Ammi visnaga |
| Definition | ChEBI: Samidin is a member of coumarins. |
