3-Methyl-2-nitrophenol CAS 4920-77-8
Introduction：Basic information about 3-Methyl-2-nitrophenol CAS 4920-77-8, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
3-Methyl-2-nitrophenol Basic information
| Product Name: | 3-Methyl-2-nitrophenol |
| Synonyms: | 3-Methyl-2-nitrophenole;m-Cresol, 2-nitro-;Phenol, 3-methyl-2-nitro-;2-NITRO-M-CRESOL;2-NITRO-3-HYDROXYTOLUENE;2-NITRO-3-CRESOL;2-METHYL-6-NITROPHENOL;3-HYDROXY-2-NITROTOLUENE |
| CAS: | 4920-77-8 |
| MF: | C7H7NO3 |
| MW: | 153.14 |
| EINECS: | 225-546-9 |
| Product Categories: | Aromatic Phenols;Phenoles and thiophenoles;Aromatics Compounds;Aromatics |
| Mol File: | 4920-77-8.mol |
3-Methyl-2-nitrophenol Chemical Properties
| Melting point | 35-39 °C (lit.) |
| Boiling point | 106-108 °C/9.5 mmHg (lit.) |
| density | 1.2744 (estimate) |
| refractive index | 1.5744 (estimate) |
| Fp | 225 °F |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | Chloroform (Slightly), Dichloromethane, Methanol (Slightly) |
| pka | 7.00±0.10(Predicted) |
| form | Solid |
| color | Light Yellow to Yellow |
| BRN | 2047479 |
| Stability: | Volatile |
| InChI | InChI=1S/C7H7NO3/c1-5-3-2-4-6(9)7(5)8(10)11/h2-4,9H,1H3 |
| InChIKey | QIORDSKCCHRSSD-UHFFFAOYSA-N |
| SMILES | C1(O)=CC=CC(C)=C1[N+]([O-])=O |
| CAS DataBase Reference | 4920-77-8(CAS DataBase Reference) |
| NIST Chemistry Reference | 3-Methyl-2-nitrophenol(4920-77-8) |
Safety Information
| Hazard Codes | Xn,Xi |
| Risk Statements | 20/21/22-36/37/38 |
| Safety Statements | 26-36/37-37/39-36 |
| RIDADR | UN 2446 6.1/PG 3 |
| WGK Germany | 3 |
| F | 10 |
| Hazard Note | Harmful/Irritant |
| HazardClass | 6.1(b) |
| PackingGroup | III |
| HS Code | 29071990 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| Chemical Properties | Yellow Solid |
| Uses | A nitrophenol derivative as antitumor agent. |
| Uses | 3-Methyl-2-nitrophenol was used to investigate the formation of nitrous acid (HONO) in the gas phase in a flow tube photoreactor upon irradiation of ortho-nitrophenols. |
| General Description | 3-Methyl-2-nitrophenol is also referred as 3-methyl-2-nitro-1-hydroxybenzene. FT-IR and FT-Raman spectra of 3-methyl-2-nitrophenol has been studied. |
3-Methyl-2-nitrophenol Preparation Products And Raw materials
| Preparation Products | 2-AMINO-3-METHOXYBENZOIC ACID-->7-Hydroxyindole-->4-BROMO-7-METHOXY-1H-INDOLE-->6-bromo-5-methyl-3,4-dihydro-2H-benzo[b][1,4]oxazine-->2-amino-4-bromo-3-methylphenol |
