Introduction：Basic information about 3-Nitrophenylboronic acid CAS 13331-27-6, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
3-Nitrophenylboronic acid Basic information
| Product Name: | 3-Nitrophenylboronic acid |
| Synonyms: | (3-nitrophenyl)-boronicaci;m-nitro-benzeneboronicaci;m-nitrobenzeneboronicacid;3-NITROPHENYLBORIC ACID;3-NITROPHENYLBORONIC ACID;3-NITROBENZENEBORONIC ACID;AKOS BRN-0128;M-NITROPHENYLBORONIC ACID |
| CAS: | 13331-27-6 |
| MF: | C6H6BNO4 |
| MW: | 166.93 |
| EINECS: | |
| Product Categories: | Boronate Ester;Potassium Trifluoroborate;Aryl Boronic Acids;Boronic Acids and Derivatives;Chemical Synthesis;Monosubstituted Aryl Boronic Acids;Organometallic Reagents;B (Classes of Boron Compounds);Organometallics;Boronic acids;Boronic Acid;Aryl;Organoborons;Substituted Boronic Acids;blocks;BoronicAcids;Boronic Acid series |
| Mol File: | 13331-27-6.mol |
|
3-Nitrophenylboronic acid Chemical Properties
| Melting point | 284-285 °C (dec.) (lit.) |
| Boiling point | 363.3±44.0 °C(Predicted) |
| density | 1.40±0.1 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | soluble in Ethanol,Methanol,Ether |
| form | Powder |
| pka | 6.93±0.10(Predicted) |
| color | Light yellow to pale brown |
| Water Solubility | soluble in hot water |
| Sensitive | Hygroscopic |
| BRN | 2938638 |
| InChI | InChI=1S/C6H6BNO4/c9-7(10)5-2-1-3-6(4-5)8(11)12/h1-4,9-10H |
| InChIKey | ZNRGSYUVFVNSAW-UHFFFAOYSA-N |
| SMILES | B(C1=CC=CC([N+]([O-])=O)=C1)(O)O |
| CAS DataBase Reference | 13331-27-6(CAS DataBase Reference) |
| EPA Substance Registry System | Boronic acid, (3-nitrophenyl)- (13331-27-6) |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-37/39-36 |
| WGK Germany | 3 |
| RTECS | CY8980000 |
| Hazard Note | Harmful |
| TSCA | TSCA listed |
| HazardClass | IRRITANT |
| HS Code | 29310095 |
| Storage Class | 11 - Combustible Solids |
3-Nitrophenylboronic acid Usage And Synthesis
| Chemical Properties | White to light yellow crystal powde |
| Uses | Catalyzes ene carbocyclization of acetylenic dicarbonyl compounds8 |
| Uses | suzuki reaction |
| Uses | 3-Nitrophenylboronic Acid is a general reagent the preparation of carbon coated copper nanoparticles and nanowires for usage in Suzuki cross coupling reactions. Also it has been used in the synthesis of oxygenated cabazoles. |
| Synthesis Reference(s) | The Journal of Organic Chemistry, 49, p. 5237, 1984 DOI: 10.1021/jo00200a045 |
3-Nitrophenylboronic acid Preparation Products And Raw materials
| Preparation Products | 6-(3-NITROPHENYL)-2-PYRIDINECARBOXALDEHYDE-->2-(3-AMINOPHENYL)PYRIDINE-->3-Bromonitrobenzene-->3-Nitrobenzyl alcohol-->3-AMINOBIPHENYL-->METHYL 3'-NITRO[1,1'-BIPHENYL]-3-CARBOXYLATE-->Benzene, 1-nitro-3-(pentyloxy)--->3'-NITRO[1,1'-BIPHENYL]-4-CARBONITRILE-->3-Aminobenzeneboronic acid-->3-NITRODIPHENYLAMINE |
