4 4'-METHYLENE-13C-DIANILINE CAS 190778-00-8
Introduction:Basic information about 4 4'-METHYLENE-13C-DIANILINE CAS 190778-00-8, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
4 4'-METHYLENE-13C-DIANILINE Basic information
| Product Name: | 4 4'-METHYLENE-13C-DIANILINE |
| Synonyms: | 4 4'-METHYLENE-13C-DIANILINE;4,4'-METHYLENE-13C-DIANILINE, 99 ATOM % 13C;4,4''-METHYLENE-DIANILINE, [METHYLENE-13C];4 4'-METHYLENE-13C-DIANILINE ISO 9001:2015 REACH;4,4′-Methylene-13C-dianiline;4,4′-Methylene-13C-dianiline, CAS 190778-00-8 |
| CAS: | 190778-00-8 |
| MF: | C13H14N2 |
| MW: | 199.27 |
| EINECS: | |
| Product Categories: | Alphabetical Listings;M;Stable Isotopes |
| Mol File: | 190778-00-8.mol |
4 4'-METHYLENE-13C-DIANILINE Chemical Properties
| Melting point | 88-92 °C |
| Fp | 230℃ |
| form | solid |
| InChI | 1S/C13H14N2/c14-12-5-1-10(2-6-12)9-11-3-7-13(15)8-4-11/h1-8H,9,14-15H2/i9+1 |
| InChIKey | YBRVSVVVWCFQMG-QBZHADDCSA-N |
| SMILES | Nc1ccc([13CH2]c2ccc(N)cc2)cc1 |
Safety Information
| Hazard Codes | T |
| Risk Statements | 45-20/21/22-43-48/20/21-51/53 |
| Safety Statements | 53-45-61 |
| RIDADR | UN 2651 6.1/PG 3 |
| WGK Germany | 3 |
| Storage Class | 6.1A - Combustible acute toxic Cat. 1 and 2 very toxic hazardous materials |
| Hazard Classifications | Acute Tox. 2 Dermal Acute Tox. 4 Oral Aquatic Chronic 2 Carc. 1B Eye Irrit. 2 Muta. 2 STOT SE 1 |
