Introduction：Basic information about 4,4'-azobis(phenol) CAS 2050-16-0, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
4,4'-azobis(phenol) Basic information
| Product Name: | 4,4'-azobis(phenol) |
| Synonyms: | 4,4ˊ-Dihydroxyazobenzene C12H10N2O2;4,4'-(E)-Diazene-1,2-diyldiphenol;4,4'-azobis(phenol);4,4'-Azodiphenol;4'-Hydroxyazobenzene-4-ol;Azobenzene-4,4'-diol;4,4`-(1,2-Diazenediyl)bisphenol;Phenol, 4,4'-azobis- |
| CAS: | 2050-16-0 |
| MF: | C12H10N2O2 |
| MW: | 214.22 |
| EINECS: | |
| Product Categories: | |
| Mol File: | 2050-16-0.mol |
|
4,4'-azobis(phenol) Chemical Properties
| Melting point | 204 °C |
| Boiling point | 449.7±30.0 °C(Predicted) |
| density | 1.24±0.1 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| pka | 8.53±0.15(Predicted) |
| Appearance | Yellow to brown Solid |
| λmax | 360nm(EtOH)(lit.) |
| InChI | InChI=1S/C12H10N2O2/c15-11-5-1-9(2-6-11)13-14-10-3-7-12(16)8-4-10/h1-8,15-16H |
| InChIKey | WKODVHZBYIBMOC-BUHFOSPRSA-N |
| SMILES | N(C1=CC=C(O)C=C1)=NC1=CC=C(O)C=C1 |
Safety Information
4,4'-azobis(phenol) Usage And Synthesis
4,4'-azobis(phenol) Preparation Products And Raw materials
| Preparation Products | 5-METHOXY-2-PHENYL-2H-INDAZOLE |
